Attributes
UniProt ID
Protein Name
Electron transfer flavoprotein subunit alpha
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1O96
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1o96A1e1o96B1e1o96B2e1o96C1e1o96D1e1o96D2e1o96E1e1o96F1e1o96F2e1o96Q1e1o96Z1e1o96Z2
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P53571 | DB03147 | FAD | 1o96 | e1o96B1 | B:196-318 |
| P53571 | DB03147 | FAD | 1o96 | e1o96B2 | B:1-191 |
| P53571 | DB03147 | FAD | 1o96 | e1o96D1 | D:196-318 |
| P53571 | DB03147 | FAD | 1o96 | e1o96D2 | D:1-191 |
| P53571 | DB03147 | FAD | 1o96 | e1o96F1 | F:196-318 |
| P53571 | DB03147 | FAD | 1o96 | e1o96Z1 | Z:196-318 |
| P53571 | DB03147 | FAD | 1o96 | e1o96Z2 | Z:1-189 |
| P53571 | DB03147 | FAD | 1o97 | e1o97D1 | D:196-318 |
| P53571 | DB03147 | FAD | 1o97 | e1o97D2 | D:1-192 |
| P53571 | DB03147 | FAD | 3clr | e3clrD1 | D:196-318 |
| P53571 | DB03147 | FAD | 3clr | e3clrD2 | D:1-192 |
| P53571 | DB03147 | FAD | 3cls | e3clsD1 | D:196-318 |
| P53571 | DB03147 | FAD | 3cls | e3clsD2 | D:1-192 |
| P53571 | DB03147 | FAD | 3clt | e3cltD1 | D:196-318 |
| P53571 | DB03147 | FAD | 3clt | e3cltD2 | D:1-192 |
| P53571 | DB03147 | FAD | 3clu | e3cluD1 | D:196-318 |
| P53571 | DB03147 | FAD | 3clu | e3cluD2 | D:1-192 |