Attributes
UniProt ID
Protein Name
Geranylgeranyl transferase type-1 subunit beta
Ligand Name
2-(N-MORPHOLINO)-ETHANESULFONIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SXGZJKUKBWWHRA-UHFFFAOYSA-N
SMILES
C1COCC[NH+]1CCS(=O)(=O)[O-]
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1N4R
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1n4rA1e1n4rB1e1n4rC1e1n4rD1e1n4rE1e1n4rF1e1n4rG1e1n4rH1e1n4rI1e1n4rJ1e1n4rK1e1n4rL1
ECOD domains from experimental PDB structures interacting with ligand DB03814
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P53610 | DB03814 | MES | 1n4r | e1n4rB1 | B:18-363 |
| P53610 | DB03814 | MES | 1n4r | e1n4rD1 | D:18-363 |
| P53610 | DB03814 | MES | 1n4r | e1n4rF1 | F:18-363 |
| P53610 | DB03814 | MES | 1n4r | e1n4rH1 | H:18-363 |
| P53610 | DB03814 | MES | 1n4r | e1n4rJ1 | J:18-363 |
| P53610 | DB03814 | MES | 1n4r | e1n4rL1 | L:18-363 |
| P53610 | DB03814 | MES | 1s64 | e1s64B1 | B:18-363 |
| P53610 | DB03814 | MES | 1s64 | e1s64D1 | D:18-363 |
| P53610 | DB03814 | MES | 1s64 | e1s64F1 | F:18-363 |
| P53610 | DB03814 | MES | 1s64 | e1s64H1 | H:18-363 |
| P53610 | DB03814 | MES | 1s64 | e1s64J1 | J:18-363 |
| P53610 | DB03814 | MES | 1s64 | e1s64L1 | L:18-363 |
| P53610 | DB03814 | MES | 1tnb | e1tnbF1 | F:18-363 |
| P53610 | DB03814 | MES | 1tno | e1tnoB1 | B:18-363 |
| P53610 | DB03814 | MES | 1tno | e1tnoF1 | F:18-363 |
| P53610 | DB03814 | MES | 1tno | e1tnoJ1 | J:18-363 |
| P53610 | DB03814 | MES | 1tnu | e1tnuF1 | F:18-363 |
| P53610 | DB03814 | MES | 1tny | e1tnyF1 | F:18-363 |
| P53610 | DB03814 | MES | 1tnz | e1tnzF1 | F:18-363 |