Attributes
UniProt ID
Protein Name
DNA polymerase subunit gamma-1
Ligand Name
2'-DEOXYCYTIDINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RGWHQCVHVJXOKC-SHYZEUOFSA-N
SMILES
C1C(C(OC1N2C=CC(=NC2=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4ZTZ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4ztzA1e4ztzA2e4ztzA3e4ztzA4e4ztzB1e4ztzB2e4ztzC1e4ztzC2
ECOD domains from experimental PDB structures interacting with ligand DB03258
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P54098 | DB03258 | DCP | 4ztz | e4ztzA1 | A:416-510,A:530-662,A:738-879 |
| P54098 | DB03258 | DCP | 4ztz | e4ztzA3 | A:880-908,A:1081-1228 |
| P54098 | DB03258 | DCP | 4ztz | e4ztzA4 | A:909-992,A:1025-1080 |
| P54098 | DB03258 | DCP | 8d33 | e8d33A1 | A:880-908,A:1081-1235 |
| P54098 | DB03258 | DCP | 8d33 | e8d33A2 | A:909-997,A:1049-1080 |
| P54098 | DB03258 | DCP | 8d33 | e8d33A4 | A:416-499,A:530-662,A:738-879 |
| P54098 | DB03258 | DCP | 8d37 | e8d37A1 | A:416-499,A:530-662,A:738-879 |
| P54098 | DB03258 | DCP | 8d37 | e8d37A3 | A:909-997,A:1049-1080 |
| P54098 | DB03258 | DCP | 8d37 | e8d37A4 | A:880-908,A:1081-1235 |
| P54098 | DB03258 | DCP | 8d3r | e8d3rA1 | A:880-908,A:1081-1235 |
| P54098 | DB03258 | DCP | 8d3r | e8d3rA3 | A:909-989,A:1049-1080 |
| P54098 | DB03258 | DCP | 8d42 | e8d42A1 | A:880-908,A:1081-1235 |
| P54098 | DB03258 | DCP | 8d42 | e8d42A2 | A:909-997,A:1049-1080 |
| P54098 | DB03258 | DCP | 8d42 | e8d42A4 | A:416-499,A:530-662,A:738-879 |