Attributes
UniProt ID
Protein Name
RecQ-like DNA helicase BLM
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4CDG
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4cdgA10e4cdgA11e4cdgA12e4cdgA9e4cdgB10e4cdgB11e4cdgB12e4cdgB9e4cdgC1e4cdgD1
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P54132 | DB16833 | ADP | 4cdg | e4cdgA10 | A:1182-1290 |
| P54132 | DB16833 | ADP | 4cdg | e4cdgA11 | A:856-1071 |
| P54132 | DB16833 | ADP | 4cdg | e4cdgA12 | A:639-855 |
| P54132 | DB16833 | ADP | 4cdg | e4cdgB10 | B:1182-1290 |
| P54132 | DB16833 | ADP | 4cdg | e4cdgB11 | B:856-1071 |
| P54132 | DB16833 | ADP | 4cdg | e4cdgB12 | B:641-855 |
| P54132 | DB16833 | ADP | 4cgz | e4cgzA3 | A:856-1071 |
| P54132 | DB16833 | ADP | 4cgz | e4cgzA4 | A:637-855 |
| P54132 | DB16833 | ADP | 4cgz | e4cgzA5 | A:1200-1290 |
| P54132 | DB16833 | ADP | 4o3m | e4o3mA2 | A:1182-1291 |
| P54132 | DB16833 | ADP | 4o3m | e4o3mA3 | A:856-1071 |
| P54132 | DB16833 | ADP | 4o3m | e4o3mA4 | A:640-855 |
| P54132 | DB16833 | ADP | 7auc | e7aucA1 | A:855-1196 |
| P54132 | DB16833 | ADP | 7auc | e7aucA2 | A:639-854 |
| P54132 | DB16833 | ADP | 7auc | e7aucA3 | A:1197-1290 |
| P54132 | DB16833 | ADP | 7aud | e7audA1 | A:855-1070 |
| P54132 | DB16833 | ADP | 7aud | e7audA2 | A:640-854 |
| P54132 | DB16833 | ADP | 7aud | e7audB2 | B:638-854 |
| P54132 | DB16833 | ADP | 7aud | e7audC1 | C:855-1196 |
| P54132 | DB16833 | ADP | 7aud | e7audC2 | C:638-854 |
| P54132 | DB16833 | ADP | 7aud | e7audD2 | D:641-854 |
| P54132 | DB16833 | ADP | 7aud | e7audE1 | E:855-1196 |
| P54132 | DB16833 | ADP | 7aud | e7audE2 | E:638-854 |
| P54132 | DB16833 | ADP | 7aud | e7audF2 | F:640-854 |