Attributes
UniProt ID
Protein Name
n/a
Ligand Name
FLAVIN MONONUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
FVTCRASFADXXNN-SCRDCRAPSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1DOR
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1dorA1e1dorB1
ECOD domains from experimental PDB structures interacting with ligand DB03247
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P54321 | DB03247 | FMN | 1dor | e1dorA1 | A:1-311 |
| P54321 | DB03247 | FMN | 1dor | e1dorB1 | B:1-311 |
| P54321 | DB03247 | FMN | 1jqv | e1jqvA1 | A:1-311 |
| P54321 | DB03247 | FMN | 1jqv | e1jqvB1 | B:1-311 |
| P54321 | DB03247 | FMN | 1jqx | e1jqxA1 | A:1-311 |
| P54321 | DB03247 | FMN | 1jqx | e1jqxB1 | B:1-311 |
| P54321 | DB03247 | FMN | 1jrb | e1jrbA1 | A:1-311 |
| P54321 | DB03247 | FMN | 1jrb | e1jrbB1 | B:1-311 |
| P54321 | DB03247 | FMN | 1jrc | e1jrcA1 | A:1-311 |
| P54321 | DB03247 | FMN | 1jrc | e1jrcB1 | B:1-311 |
| P54321 | DB03247 | FMN | 1jub | e1jubA1 | A:1-311 |
| P54321 | DB03247 | FMN | 1jub | e1jubB1 | B:1-311 |
| P54321 | DB03247 | FMN | 1jue | e1jueA1 | A:1-311 |
| P54321 | DB03247 | FMN | 1jue | e1jueB1 | B:1-311 |
| P54321 | DB03247 | FMN | 1ovd | e1ovdA1 | A:1-311 |
| P54321 | DB03247 | FMN | 1ovd | e1ovdB1 | B:1-311 |
| P54321 | DB03247 | FMN | 2bsl | e2bslA1 | A:1-311 |
| P54321 | DB03247 | FMN | 2bsl | e2bslB1 | B:1-311 |
| P54321 | DB03247 | FMN | 2bx7 | e2bx7A1 | A:1-311 |
| P54321 | DB03247 | FMN | 2bx7 | e2bx7B1 | B:1-311 |
| P54321 | DB03247 | FMN | 2dor | e2dorA1 | A:1-311 |
| P54321 | DB03247 | FMN | 2dor | e2dorB1 | B:1-311 |