Attributes
UniProt ID
Protein Name
Bifunctional protein MdtA
Ligand Name
NADP NICOTINAMIDE-ADENINE-DINUCLEOTIDE PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XJLXINKUBYWONI-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)OP(=O)(O)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1LUA
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1luaA1e1luaA2e1luaB1e1luaB2e1luaC1e1luaC2
ECOD domains from experimental PDB structures interacting with ligand DB03461
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P55818 | DB03461 | NAP | 1lua | e1luaA1 | A:98-288 |
| P55818 | DB03461 | NAP | 1lua | e1luaA2 | A:2-97 |
| P55818 | DB03461 | NAP | 1lua | e1luaB1 | B:98-288 |
| P55818 | DB03461 | NAP | 1lua | e1luaB2 | B:2-97 |
| P55818 | DB03461 | NAP | 1lua | e1luaC1 | C:98-288 |
| P55818 | DB03461 | NAP | 1lua | e1luaC2 | C:2-97 |
| P55818 | DB03461 | NAP | 6tlk | e6tlkA1 | A:2-97 |
| P55818 | DB03461 | NAP | 6tlk | e6tlkA2 | A:98-290 |
| P55818 | DB03461 | NAP | 6tlk | e6tlkB1 | B:2-97 |
| P55818 | DB03461 | NAP | 6tlk | e6tlkB2 | B:98-289 |
| P55818 | DB03461 | NAP | 6tlk | e6tlkC1 | C:98-289 |
| P55818 | DB03461 | NAP | 6tlk | e6tlkC2 | C:2-97 |
| P55818 | DB03461 | NAP | 6tlk | e6tlkD1 | D:98-289 |
| P55818 | DB03461 | NAP | 6tlk | e6tlkD2 | D:2-97 |
| P55818 | DB03461 | NAP | 6tlk | e6tlkE1 | E:98-289 |
| P55818 | DB03461 | NAP | 6tlk | e6tlkE2 | E:2-97 |
| P55818 | DB03461 | NAP | 6tlk | e6tlkF1 | F:98-289 |
| P55818 | DB03461 | NAP | 6tlk | e6tlkF2 | F:2-97 |
| P55818 | DB03461 | NAP | 6tm3 | e6tm3A1 | A:98-290 |
| P55818 | DB03461 | NAP | 6tm3 | e6tm3A2 | A:2-97 |