Attributes
UniProt ID
Protein Name
Photosystem I P700 chlorophyll a apoprotein A2 1
Ligand Name
CHLOROPHYLL A
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ATNHDLDRLWWWCB-AENOIHSZSA-M
SMILES
CCC1=C(C2=Cc3c(c(c4n3[Mg]56[N]2=C1C=C7N5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C=C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6JEO
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6jeoaA1e6jeoaA2e6jeoaB1e6jeoaB2e6jeoaC1e6jeoaD1e6jeoaE1e6jeoaF1e6jeoaI1e6jeoaJ1e6jeoaK1e6jeoaL1e6jeoaM1e6jeoaX1e6jeobA1e6jeobA2e6jeobB1e6jeobB2e6jeobC1e6jeobD1e6jeobE1e6jeobF1e6jeobI1e6jeobJ1e6jeobK1e6jeobL1e6jeobM1e6jeobX1e6jeocA1e6jeocA2e6jeocB1e6jeocB2e6jeocC1e6jeocD1e6jeocE1e6jeocF1e6jeocI1e6jeocJ1e6jeocK1e6jeocL1e6jeocM1e6jeocX1e6jeodA1e6jeodA2e6jeodB1e6jeodB2e6jeodC1e6jeodD1e6jeodE1e6jeodF1e6jeodI1e6jeodJ1e6jeodK1e6jeodL1e6jeodM1e6jeodX1
ECOD domains from experimental PDB structures interacting with ligand DB02133
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P58565 | DB02133 | CLA | 6jeo | e6jeoaB1 | aB:410-740 |
| P58565 | DB02133 | CLA | 6jeo | e6jeoaB2 | aB:2-409 |
| P58565 | DB02133 | CLA | 6jeo | e6jeobB1 | bB:2-409 |
| P58565 | DB02133 | CLA | 6jeo | e6jeobB2 | bB:410-740 |
| P58565 | DB02133 | CLA | 6jeo | e6jeocB1 | cB:2-409 |
| P58565 | DB02133 | CLA | 6jeo | e6jeocB2 | cB:410-740 |
| P58565 | DB02133 | CLA | 6jeo | e6jeodB1 | dB:410-740 |
| P58565 | DB02133 | CLA | 6jeo | e6jeodB2 | dB:2-409 |
| P58565 | DB02133 | CLA | 6k61 | e6k61B1 | B:2-409 |
| P58565 | DB02133 | CLA | 6k61 | e6k61B2 | B:410-741 |
| P58565 | DB02133 | CLA | 6k61 | e6k61b1 | b:410-741 |
| P58565 | DB02133 | CLA | 6k61 | e6k61b2 | b:2-409 |
| P58565 | DB02133 | CLA | 6tcl | e6tclB12 | B1:410-741 |
| P58565 | DB02133 | CLA | 6tcl | e6tclB2 | B:410-741 |
| P58565 | DB02133 | CLA | 6tcl | e6tclB22 | B2:410-741 |
| P58565 | DB02133 | CLA | 6tcl | e6tclBB2 | BB:410-741 |
| P58565 | DB02133 | CLA | 7y3f | e7y3fB1 | B:410-740 |
| P58565 | DB02133 | CLA | 7y3f | e7y3fB2 | B:2-409 |