Attributes
UniProt ID
Protein Name
Magnesium-chelatase subunit ChlI
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 8OSF
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse8osfA1e8osfA2e8osfB1e8osfB2e8osfC1e8osfC2e8osfD1e8osfD2e8osfE1e8osfE2e8osfF1e8osfF2
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P58571 | DB00171 | ATP | 8osf | e8osfA1 | A:269-353 |
| P58571 | DB00171 | ATP | 8osf | e8osfA2 | A:14-268 |
| P58571 | DB00171 | ATP | 8osf | e8osfB1 | B:269-353 |
| P58571 | DB00171 | ATP | 8osf | e8osfB2 | B:14-268 |
| P58571 | DB00171 | ATP | 8osf | e8osfC1 | C:269-353 |
| P58571 | DB00171 | ATP | 8osf | e8osfC2 | C:14-268 |
| P58571 | DB00171 | ATP | 8osf | e8osfD1 | D:14-268 |
| P58571 | DB00171 | ATP | 8osf | e8osfD2 | D:269-353 |
| P58571 | DB00171 | ATP | 8osf | e8osfE1 | E:14-268 |
| P58571 | DB00171 | ATP | 8osf | e8osfE2 | E:269-353 |
| P58571 | DB00171 | ATP | 8osf | e8osfF1 | F:14-64,F:147-156,F:189-269 |
| P58571 | DB00171 | ATP | 8osf | e8osfF2 | F:270-353 |
| P58571 | DB00171 | ATP | 8osg | e8osgA1 | A:14-79,A:103-268 |
| P58571 | DB00171 | ATP | 8osg | e8osgA2 | A:269-353 |
| P58571 | DB00171 | ATP | 8osg | e8osgB1 | B:14-268 |
| P58571 | DB00171 | ATP | 8osg | e8osgB2 | B:269-353 |
| P58571 | DB00171 | ATP | 8osg | e8osgC1 | C:269-353 |
| P58571 | DB00171 | ATP | 8osg | e8osgC2 | C:14-268 |
| P58571 | DB00171 | ATP | 8osg | e8osgD1 | D:14-268 |
| P58571 | DB00171 | ATP | 8osg | e8osgD2 | D:269-353 |
| P58571 | DB00171 | ATP | 8osg | e8osgE1 | E:269-353 |
| P58571 | DB00171 | ATP | 8osg | e8osgE2 | E:14-268 |