Attributes
UniProt ID
Protein Name
Spike glycoprotein
Ligand Name
LINOLEIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OYHQOLUKZRVURQ-HZJYTTRNSA-N
SMILES
CCCCCC=CCC=CCCCCCCCC(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7ZH1
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7zh1A1e7zh1A2e7zh1A3e7zh1A4e7zh1B1e7zh1B2e7zh1B3e7zh1B4e7zh1C1e7zh1C2e7zh1C3e7zh1C4
ECOD domains from experimental PDB structures interacting with ligand DB14104
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P59594 | DB14104 | EIC | 7zh1 | e7zh1A1 | A:316-515 |
| P59594 | DB14104 | EIC | 7zh1 | e7zh1B3 | B:316-515 |
| P59594 | DB14104 | EIC | 7zh1 | e7zh1C3 | C:316-515 |
| P59594 | DB14104 | EIC | 7zh2 | e7zh2A3 | A:316-515 |
| P59594 | DB14104 | EIC | 7zh2 | e7zh2B4 | B:316-515 |
| P59594 | DB14104 | EIC | 7zh2 | e7zh2C3 | C:316-515 |
| P59594 | DB14104 | EIC | 8h0x | e8h0xA2 | A:316-515 |
| P59594 | DB14104 | EIC | 8h0x | e8h0xB2 | B:316-515 |
| P59594 | DB14104 | EIC | 8h0x | e8h0xC3 | C:316-515 |
| P59594 | DB14104 | EIC | 8h0y | e8h0yA1 | A:316-515 |
| P59594 | DB14104 | EIC | 8h0y | e8h0yB1 | B:316-515 |
| P59594 | DB14104 | EIC | 8h0y | e8h0yC1 | C:316-515 |
| P59594 | DB14104 | EIC | 8h0z | e8h0zA3 | A:316-515 |
| P59594 | DB14104 | EIC | 8h0z | e8h0zB2 | B:316-515 |
| P59594 | DB14104 | EIC | 8h0z | e8h0zC3 | C:316-515 |
| P59594 | DB14104 | EIC | 8h10 | e8h10A3 | A:316-515 |
| P59594 | DB14104 | EIC | 8h10 | e8h10B3 | B:316-515 |
| P59594 | DB14104 | EIC | 8h10 | e8h10C2 | C:316-515 |
| P59594 | DB14104 | EIC | 8h14 | e8h14A1 | A:316-515 |
| P59594 | DB14104 | EIC | 8h14 | e8h14B4 | B:316-515 |
| P59594 | DB14104 | EIC | 8h14 | e8h14C4 | C:316-515 |