Attributes
UniProt ID
Protein Name
Argininosuccinate synthase
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1J1Z
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1j1zA1e1j1zA2e1j1zB1e1j1zB2e1j1zC1e1j1zC2e1j1zD1e1j1zD2
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P59846 | DB00171 | ATP | 1j1z | e1j1zA1 | A:171-395 |
| P59846 | DB00171 | ATP | 1j1z | e1j1zA2 | A:1-164 |
| P59846 | DB00171 | ATP | 1j1z | e1j1zB1 | B:171-395 |
| P59846 | DB00171 | ATP | 1j1z | e1j1zB2 | B:1-164 |
| P59846 | DB00171 | ATP | 1j1z | e1j1zC1 | C:171-395 |
| P59846 | DB00171 | ATP | 1j1z | e1j1zC2 | C:1-164 |
| P59846 | DB00171 | ATP | 1j1z | e1j1zD1 | D:171-395 |
| P59846 | DB00171 | ATP | 1j1z | e1j1zD2 | D:1-164 |
| P59846 | DB00171 | ATP | 1j21 | e1j21A1 | A:171-395 |
| P59846 | DB00171 | ATP | 1j21 | e1j21A2 | A:1-164 |
| P59846 | DB00171 | ATP | 1j21 | e1j21B1 | B:171-395 |
| P59846 | DB00171 | ATP | 1j21 | e1j21B2 | B:1-164 |
| P59846 | DB00171 | ATP | 1j21 | e1j21C1 | C:171-395 |
| P59846 | DB00171 | ATP | 1j21 | e1j21C2 | C:1-164 |
| P59846 | DB00171 | ATP | 1j21 | e1j21D1 | D:171-395 |
| P59846 | DB00171 | ATP | 1j21 | e1j21D2 | D:1-164 |
| P59846 | DB00171 | ATP | 1kh2 | e1kh2A1 | A:171-395 |
| P59846 | DB00171 | ATP | 1kh2 | e1kh2A2 | A:1-164 |
| P59846 | DB00171 | ATP | 1kh2 | e1kh2B1 | B:171-395 |
| P59846 | DB00171 | ATP | 1kh2 | e1kh2B2 | B:1-164 |
| P59846 | DB00171 | ATP | 1kh2 | e1kh2C1 | C:171-395 |
| P59846 | DB00171 | ATP | 1kh2 | e1kh2C2 | C:1-164 |
| P59846 | DB00171 | ATP | 1kh2 | e1kh2D1 | D:171-395 |
| P59846 | DB00171 | ATP | 1kh2 | e1kh2D2 | D:1-164 |