Attributes
UniProt ID
Protein Name
Actin
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1YAG
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1yagA1e1yagA2e1yagG1
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P60010 | DB00171 | ATP | 1yag | e1yagA1 | A:7-146 |
| P60010 | DB00171 | ATP | 1yag | e1yagA2 | A:147-371 |
| P60010 | DB00171 | ATP | 1yvn | e1yvnA1 | A:7-146 |
| P60010 | DB00171 | ATP | 1yvn | e1yvnA2 | A:147-371 |
| P60010 | DB00171 | ATP | 5nbm | e5nbmC1 | C:2-146 |
| P60010 | DB00171 | ATP | 5nbm | e5nbmC2 | C:147-374 |
| P60010 | DB00171 | ATP | 5nbm | e5nbmD1 | D:147-374 |
| P60010 | DB00171 | ATP | 5nbm | e5nbmD2 | D:2-146 |
| P60010 | DB00171 | ATP | 5nbn | e5nbnC1 | C:5-146 |
| P60010 | DB00171 | ATP | 5nbn | e5nbnC2 | C:147-374 |
| P60010 | DB00171 | ATP | 5nbn | e5nbnD1 | D:147-374 |
| P60010 | DB00171 | ATP | 5nbn | e5nbnD2 | D:5-146 |
| P60010 | DB00171 | ATP | 7vvy | e7vvyG1 | G:147-375 |
| P60010 | DB00171 | ATP | 7vvy | e7vvyG2 | G:5-146 |
| P60010 | DB00171 | ATP | 7vvz | e7vvzG1 | G:147-375 |
| P60010 | DB00171 | ATP | 7vvz | e7vvzG2 | G:5-146 |
| P60010 | DB00171 | ATP | 8a5a | e8a5aV1 | V:3-146 |
| P60010 | DB00171 | ATP | 8a5a | e8a5aV2 | V:147-375 |