Attributes
UniProt ID
Protein Name
Actin, cytoplasmic 1
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1HLU
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1hluA1e1hluA2e1hluP1
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P60712 | DB00171 | ATP | 1hlu | e1hluA1 | A:7-146 |
| P60712 | DB00171 | ATP | 1hlu | e1hluA2 | A:147-371 |
| P60712 | DB00171 | ATP | 2btf | e2btfA1 | A:7-146 |
| P60712 | DB00171 | ATP | 2btf | e2btfA2 | A:147-371 |
| P60712 | DB00171 | ATP | 2oan | e2oanA1 | A:7-146 |
| P60712 | DB00171 | ATP | 2oan | e2oanA2 | A:147-371 |
| P60712 | DB00171 | ATP | 2oan | e2oanB1 | B:4-136 |
| P60712 | DB00171 | ATP | 2oan | e2oanB2 | B:147-371 |
| P60712 | DB00171 | ATP | 2oan | e2oanC1 | C:7-146 |
| P60712 | DB00171 | ATP | 2oan | e2oanC2 | C:147-371 |
| P60712 | DB00171 | ATP | 2oan | e2oanD1 | D:7-146 |
| P60712 | DB00171 | ATP | 2oan | e2oanD2 | D:147-371 |
| P60712 | DB00171 | ATP | 3u4l | e3u4lA3 | A:6-139 |
| P60712 | DB00171 | ATP | 3u4l | e3u4lA4 | A:140-375 |
| P60712 | DB00171 | ATP | 3ub5 | e3ub5A3 | A:6-139 |
| P60712 | DB00171 | ATP | 3ub5 | e3ub5A4 | A:140-375 |