Attributes
UniProt ID
Protein Name
Erythronate-4-phosphate dehydrogenase
Ligand Name
NICOTINAMIDE-ADENINE-DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BAWFJGJZGIEFAR-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3OET
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3oetA1e3oetA2e3oetA3e3oetB1e3oetB2e3oetB3e3oetC1e3oetC2e3oetC3e3oetD1e3oetD2e3oetD3e3oetE1e3oetE2e3oetE3e3oetF1e3oetF2e3oetF3e3oetG1e3oetG2e3oetG3e3oetH1e3oetH2e3oetH3
ECOD domains from experimental PDB structures interacting with ligand DB14128
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P60802 | DB14128 | NAD | 3oet | e3oetA1 | A:111-241 |
| P60802 | DB14128 | NAD | 3oet | e3oetA2 | A:242-376 |
| P60802 | DB14128 | NAD | 3oet | e3oetA3 | A:-1-110 |
| P60802 | DB14128 | NAD | 3oet | e3oetB1 | B:111-241 |
| P60802 | DB14128 | NAD | 3oet | e3oetB2 | B:242-376 |
| P60802 | DB14128 | NAD | 3oet | e3oetB3 | B:-2-110 |
| P60802 | DB14128 | NAD | 3oet | e3oetC1 | C:111-250 |
| P60802 | DB14128 | NAD | 3oet | e3oetC2 | C:251-376 |
| P60802 | DB14128 | NAD | 3oet | e3oetC3 | C:-2-110 |
| P60802 | DB14128 | NAD | 3oet | e3oetD1 | D:111-241 |
| P60802 | DB14128 | NAD | 3oet | e3oetD2 | D:242-377 |
| P60802 | DB14128 | NAD | 3oet | e3oetD3 | D:-2-110 |
| P60802 | DB14128 | NAD | 3oet | e3oetE1 | E:111-241 |
| P60802 | DB14128 | NAD | 3oet | e3oetE2 | E:242-375 |
| P60802 | DB14128 | NAD | 3oet | e3oetE3 | E:1-110 |
| P60802 | DB14128 | NAD | 3oet | e3oetF1 | F:1-110 |
| P60802 | DB14128 | NAD | 3oet | e3oetF2 | F:251-376 |
| P60802 | DB14128 | NAD | 3oet | e3oetF3 | F:111-250 |
| P60802 | DB14128 | NAD | 3oet | e3oetG1 | G:111-241 |
| P60802 | DB14128 | NAD | 3oet | e3oetG2 | G:242-375 |
| P60802 | DB14128 | NAD | 3oet | e3oetG3 | G:1-110 |
| P60802 | DB14128 | NAD | 3oet | e3oetH1 | H:111-241 |
| P60802 | DB14128 | NAD | 3oet | e3oetH2 | H:242-376 |
| P60802 | DB14128 | NAD | 3oet | e3oetH3 | H:-1-110 |