Attributes
UniProt ID
Protein Name
Cell division control protein 42 homolog
Ligand Name
GUANOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QGWNDRXFNXRZMB-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1A4R
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1a4rA1e1a4rB1
ECOD domains from experimental PDB structures interacting with ligand DB04315
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P60953 | DB04315 | GDP | 1a4r | e1a4rA1 | A:1-181 |
| P60953 | DB04315 | GDP | 1an0 | e1an0A1 | A:1-181 |
| P60953 | DB04315 | GDP | 1an0 | e1an0B1 | B:1-183 |
| P60953 | DB04315 | GDP | 1doa | e1doaA1 | A:-1-181 |
| P60953 | DB04315 | GDP | 1grn | e1grnA1 | A:1-181 |
| P60953 | DB04315 | GDP | 2ngr | e2ngrA1 | A:1-181 |
| P60953 | DB04315 | GDP | 2wmn | e2wmnB1 | B:-1-177 |
| P60953 | DB04315 | GDP | 3qbv | e3qbvA1 | A:1-178 |
| P60953 | DB04315 | GDP | 3qbv | e3qbvC1 | C:1-171 |
| P60953 | DB04315 | GDP | 4did | e4didA1 | A:0-181 |
| P60953 | DB04315 | GDP | 4itr | e4itrC1 | C:1-169 |
| P60953 | DB04315 | GDP | 4itr | e4itrD1 | D:3-179 |
| P60953 | DB04315 | GDP | 5hzk | e5hzkA1 | A:3-178 |
| P60953 | DB04315 | GDP | 5hzk | e5hzkC1 | C:3-178 |
| P60953 | DB04315 | GDP | 6siu | e6siuC1 | C:1-191 |
| P60953 | DB04315 | GDP | 6siu | e6siuD1 | D:1-179 |
| P60953 | DB04315 | GDP | 6tkz | e6tkzC1 | C:2-178 |
| P60953 | DB04315 | GDP | 6tkz | e6tkzD1 | D:1-178 |
| P60953 | DB04315 | GDP | 7s0y | e7s0yB1 | B:0-179 |