Attributes
UniProt ID
Protein Name
Ras-related protein Rab-8A
Ligand Name
GUANOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QGWNDRXFNXRZMB-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4LHV
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4lhvA1e4lhvB1e4lhvC1e4lhvD1e4lhvE1
ECOD domains from experimental PDB structures interacting with ligand DB04315
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P61006 | DB04315 | GDP | 4lhv | e4lhvA1 | A:3-176 |
| P61006 | DB04315 | GDP | 4lhv | e4lhvB1 | B:5-176 |
| P61006 | DB04315 | GDP | 4lhv | e4lhvC1 | C:6-176 |
| P61006 | DB04315 | GDP | 4lhv | e4lhvD1 | D:6-176 |
| P61006 | DB04315 | GDP | 4lhv | e4lhvE1 | E:5-174 |
| P61006 | DB04315 | GDP | 4lhy | e4lhyA1 | A:3-177 |
| P61006 | DB04315 | GDP | 4lhy | e4lhyB1 | B:3-177 |
| P61006 | DB04315 | GDP | 4li0 | e4li0A1 | A:6-176 |
| P61006 | DB04315 | GDP | 4li0 | e4li0B1 | B:5-175 |
| P61006 | DB04315 | GDP | 6stf | e6stfA1 | A:5-178 |
| P61006 | DB04315 | GDP | 6stf | e6stfB1 | B:5-177 |
| P61006 | DB04315 | GDP | 6stf | e6stfC1 | C:6-176 |
| P61006 | DB04315 | GDP | 6stf | e6stfD1 | D:7-175 |
| P61006 | DB04315 | GDP | 6stf | e6stfE1 | E:6-177 |
| P61006 | DB04315 | GDP | 7bwt | e7bwtB1 | B:3-180 |