Attributes
UniProt ID
Protein Name
Thioredoxin reductase
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4J56
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4j56A1e4j56A2e4j56A3e4j56B7e4j56B8e4j56B9e4j56C7e4j56C8e4j56C9e4j56D7e4j56D8e4j56D9e4j56E1e4j56F1e4j56G1e4j56H1
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P61076 | DB03147 | FAD | 4j56 | e4j56A1 | A:38-203,A:317-389 |
| P61076 | DB03147 | FAD | 4j56 | e4j56A2 | A:390-541 |
| P61076 | DB03147 | FAD | 4j56 | e4j56A3 | A:204-316 |
| P61076 | DB03147 | FAD | 4j56 | e4j56B7 | B:203-315 |
| P61076 | DB03147 | FAD | 4j56 | e4j56B8 | B:389-541 |
| P61076 | DB03147 | FAD | 4j56 | e4j56B9 | B:38-202,B:316-388 |
| P61076 | DB03147 | FAD | 4j56 | e4j56C7 | C:203-315 |
| P61076 | DB03147 | FAD | 4j56 | e4j56C8 | C:389-541 |
| P61076 | DB03147 | FAD | 4j56 | e4j56C9 | C:38-202,C:316-388 |
| P61076 | DB03147 | FAD | 4j56 | e4j56D7 | D:203-315 |
| P61076 | DB03147 | FAD | 4j56 | e4j56D8 | D:389-541 |
| P61076 | DB03147 | FAD | 4j56 | e4j56D9 | D:38-202,D:316-388 |
| P61076 | DB03147 | FAD | 4j57 | e4j57A2 | A:203-315 |
| P61076 | DB03147 | FAD | 4j57 | e4j57A4 | A:389-536 |
| P61076 | DB03147 | FAD | 4j57 | e4j57A5 | A:38-202,A:316-388 |
| P61076 | DB03147 | FAD | 4j57 | e4j57B2 | B:203-315 |
| P61076 | DB03147 | FAD | 4j57 | e4j57B4 | B:389-536 |
| P61076 | DB03147 | FAD | 4j57 | e4j57B5 | B:38-202,B:316-388 |