Attributes
UniProt ID
Protein Name
Malate dehydrogenase
Ligand Name
NICOTINAMIDE-ADENINE-DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BAWFJGJZGIEFAR-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1EMD
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1emdA1e1emdA2
ECOD domains from experimental PDB structures interacting with ligand DB14128
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P61889 | DB14128 | NAD | 1emd | e1emdA1 | A:146-312 |
| P61889 | DB14128 | NAD | 1emd | e1emdA2 | A:1-145 |
| P61889 | DB14128 | NAD | 1ib6 | e1ib6A2 | A:1-145 |
| P61889 | DB14128 | NAD | 1ib6 | e1ib6A3 | A:146-312 |
| P61889 | DB14128 | NAD | 1ib6 | e1ib6C1 | C:146-312 |
| P61889 | DB14128 | NAD | 1ib6 | e1ib6C2 | C:1-145 |
| P61889 | DB14128 | NAD | 1ib6 | e1ib6D2 | D:1-145 |
| P61889 | DB14128 | NAD | 1ib6 | e1ib6D3 | D:146-312 |
| P61889 | DB14128 | NAD | 1ie3 | e1ie3A2 | A:1-145 |
| P61889 | DB14128 | NAD | 1ie3 | e1ie3A3 | A:146-312 |
| P61889 | DB14128 | NAD | 1ie3 | e1ie3B1 | B:146-312 |
| P61889 | DB14128 | NAD | 1ie3 | e1ie3B2 | B:1-145 |
| P61889 | DB14128 | NAD | 1ie3 | e1ie3C1 | C:146-312 |
| P61889 | DB14128 | NAD | 1ie3 | e1ie3C2 | C:1-145 |
| P61889 | DB14128 | NAD | 1ie3 | e1ie3D2 | D:1-145 |
| P61889 | DB14128 | NAD | 1ie3 | e1ie3D3 | D:146-312 |