Attributes
UniProt ID
Protein Name
ADP-ribosylation factor 6
Ligand Name
GUANOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XKMLYUALXHKNFT-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2A5D
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2a5dA1e2a5dB2
ECOD domains from experimental PDB structures interacting with ligand DB04137
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P62330 | DB04137 | GTP | 2a5d | e2a5dA1 | A:14-173 |
| P62330 | DB04137 | GTP | 2a5f | e2a5fA1 | A:14-173 |
| P62330 | DB04137 | GTP | 2a5g | e2a5gA1 | A:14-173 |
| P62330 | DB04137 | GTP | 2w83 | e2w83A1 | A:12-172 |
| P62330 | DB04137 | GTP | 2w83 | e2w83B1 | B:12-172 |
| P62330 | DB04137 | GTP | 2w83 | e2w83E1 | E:11-172 |
| P62330 | DB04137 | GTP | 3pcr | e3pcrB1 | B:14-173 |
| P62330 | DB04137 | GTP | 4fme | e4fmeC1 | C:14-173 |
| P62330 | DB04137 | GTP | 4fme | e4fmeF1 | F:14-173 |
| P62330 | DB04137 | GTP | 4kax | e4kaxA1 | A:12-174 |
| P62330 | DB04137 | GTP | 7xrd | e7xrdA1 | A:11-174 |
| P62330 | DB04137 | GTP | 7xrd | e7xrdB1 | B:11-174 |
| P62330 | DB04137 | GTP | 7xrd | e7xrdC1 | C:11-174 |
| P62330 | DB04137 | GTP | 7xrd | e7xrdD1 | D:11-174 |