Attributes
UniProt ID
Protein Name
Ras-related protein Rab-11A
Ligand Name
GUANOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QGWNDRXFNXRZMB-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4LWZ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4lwzA1e4lwzB1e4lwzC1e4lwzD1
ECOD domains from experimental PDB structures interacting with ligand DB04315
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P62491 | DB04315 | GDP | 4lwz | e4lwzA1 | A:7-173 |
| P62491 | DB04315 | GDP | 4lwz | e4lwzC1 | C:10-172 |
| P62491 | DB04315 | GDP | 4lx0 | e4lx0A1 | A:7-177 |
| P62491 | DB04315 | GDP | 4lx0 | e4lx0C1 | C:7-177 |
| P62491 | DB04315 | GDP | 5c4g | e5c4gB1 | B:7-173 |
| P62491 | DB04315 | GDP | 5euq | e5euqB1 | B:7-173 |
| P62491 | DB04315 | GDP | 5fbq | e5fbqB1 | B:9-176 |
| P62491 | DB04315 | GDP | 5jcz | e5jczA1 | A:6-177 |
| P62491 | DB04315 | GDP | 5jcz | e5jczD1 | D:5-177 |
| P62491 | DB04315 | GDP | 5jcz | e5jczI1 | I:11-174 |
| P62491 | DB04315 | GDP | 6iy1 | e6iy1A1 | A:9-173 |
| P62491 | DB04315 | GDP | 6iy1 | e6iy1B1 | B:9-173 |
| P62491 | DB04315 | GDP | 6iy1 | e6iy1C1 | C:9-173 |
| P62491 | DB04315 | GDP | 6iy1 | e6iy1D1 | D:8-173 |
| P62491 | DB04315 | GDP | 6iy1 | e6iy1E1 | E:9-173 |
| P62491 | DB04315 | GDP | 6iy1 | e6iy1F1 | F:6-173 |