Attributes
UniProt ID
Protein Name
Chloramphenicol acetyltransferase
Ligand Name
CHLORAMPHENICOL
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
WIIZWVCIJKGZOK-RKDXNWHRSA-N
SMILES
c1cc(ccc1C(C(CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-]
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3U9F
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3u9fA1e3u9fB1e3u9fC1e3u9fD1e3u9fE1e3u9fF1e3u9fG1e3u9fH1e3u9fI1e3u9fJ1e3u9fK1e3u9fL1e3u9fM1e3u9fN1e3u9fO1e3u9fP1e3u9fR1e3u9fS1
ECOD domains from experimental PDB structures interacting with ligand DB00446
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P62577 | DB00446 | CLM | 3u9f | e3u9fA1 | A:1-216 |
| P62577 | DB00446 | CLM | 3u9f | e3u9fB1 | B:1-216 |
| P62577 | DB00446 | CLM | 3u9f | e3u9fC1 | C:1-216 |
| P62577 | DB00446 | CLM | 3u9f | e3u9fD1 | D:1-216 |
| P62577 | DB00446 | CLM | 3u9f | e3u9fE1 | E:1-216 |
| P62577 | DB00446 | CLM | 3u9f | e3u9fF1 | F:1-216 |
| P62577 | DB00446 | CLM | 3u9f | e3u9fG1 | G:1-216 |
| P62577 | DB00446 | CLM | 3u9f | e3u9fH1 | H:1-216 |
| P62577 | DB00446 | CLM | 3u9f | e3u9fI1 | I:1-216 |
| P62577 | DB00446 | CLM | 3u9f | e3u9fJ1 | J:1-216 |
| P62577 | DB00446 | CLM | 3u9f | e3u9fK1 | K:1-216 |
| P62577 | DB00446 | CLM | 3u9f | e3u9fL1 | L:1-216 |
| P62577 | DB00446 | CLM | 3u9f | e3u9fM1 | M:1-216 |
| P62577 | DB00446 | CLM | 3u9f | e3u9fN1 | N:1-216 |
| P62577 | DB00446 | CLM | 3u9f | e3u9fO1 | O:1-216 |
| P62577 | DB00446 | CLM | 3u9f | e3u9fP1 | P:1-216 |
| P62577 | DB00446 | CLM | 3u9f | e3u9fR1 | R:1-216 |
| P62577 | DB00446 | CLM | 3u9f | e3u9fS1 | S:1-216 |