Attributes
UniProt ID
Protein Name
Beta-lactamase TEM
Ligand Name
TAZOBACTAM INTERMEDIATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ANZZKUOZZHRUQC-AARLMMRRSA-N
SMILES
CC(Cn1ccnn1)(C(C(=O)O)NC=CC=O)S(=O)=O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7QLP
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7qlpA1e7qlpA2e7qlpB1e7qlpB2e7qlpC1e7qlpC2e7qlpD1e7qlpD2e7qlpE1e7qlpE2e7qlpF1e7qlpF2
ECOD domains from experimental PDB structures interacting with ligand DB03834
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P62593 | DB03834 | TBE | 7qlp | e7qlpA1 | A:67-180 |
| P62593 | DB03834 | TBE | 7qlp | e7qlpA2 | A:26-66,A:181-288 |
| P62593 | DB03834 | TBE | 7qlp | e7qlpC1 | C:26-66,C:181-288 |
| P62593 | DB03834 | TBE | 7qlp | e7qlpC2 | C:67-180 |
| P62593 | DB03834 | TBE | 7qlp | e7qlpD1 | D:67-180 |
| P62593 | DB03834 | TBE | 7qlp | e7qlpD2 | D:26-66,D:181-288 |
| P62593 | DB03834 | TBE | 7qlp | e7qlpE1 | E:67-180 |
| P62593 | DB03834 | TBE | 7qlp | e7qlpE2 | E:26-66,E:181-288 |
| P62593 | DB03834 | TBE | 7qnk | e7qnkA1 | A:26-66,A:181-288 |
| P62593 | DB03834 | TBE | 7qnk | e7qnkA2 | A:67-180 |
| P62593 | DB03834 | TBE | 7qnk | e7qnkB1 | B:67-180 |
| P62593 | DB03834 | TBE | 7qnk | e7qnkB2 | B:26-66,B:181-288 |
| P62593 | DB03834 | TBE | 7qnk | e7qnkC1 | C:67-180 |
| P62593 | DB03834 | TBE | 7qnk | e7qnkC2 | C:26-66,C:181-288 |
| P62593 | DB03834 | TBE | 7qnk | e7qnkD1 | D:26-66,D:181-288 |
| P62593 | DB03834 | TBE | 7qnk | e7qnkD2 | D:67-180 |
| P62593 | DB03834 | TBE | 7qnk | e7qnkE1 | E:26-66,E:181-288 |
| P62593 | DB03834 | TBE | 7qnk | e7qnkE2 | E:67-180 |