Attributes
UniProt ID
Protein Name
2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase
Ligand Name
GERANYL DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
GVVPGTZRZFNKDS-JXMROGBWSA-N
SMILES
CC(=CCCC(=CCOP(=O)(O)OP(=O)(O)O)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1H47
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1h47A1e1h47B1e1h47C1e1h47D1e1h47E1e1h47F1
ECOD domains from experimental PDB structures interacting with ligand DB02552
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P62617 | DB02552 | GPP | 1h47 | e1h47A1 | A:0-156 |
| P62617 | DB02552 | GPP | 1h47 | e1h47B1 | B:0-156 |
| P62617 | DB02552 | GPP | 1h47 | e1h47C1 | C:0-156 |
| P62617 | DB02552 | GPP | 1h47 | e1h47D1 | D:0-156 |
| P62617 | DB02552 | GPP | 1h47 | e1h47E1 | E:0-156 |
| P62617 | DB02552 | GPP | 1h47 | e1h47F1 | F:0-156 |
| P62617 | DB02552 | GPP | 1yqn | e1yqnA1 | A:-1-156 |
| P62617 | DB02552 | GPP | 2amt | e2amtA1 | A:1-156 |
| P62617 | DB02552 | GPP | 2amt | e2amtB1 | B:1-156 |
| P62617 | DB02552 | GPP | 2amt | e2amtC1 | C:1-156 |
| P62617 | DB02552 | GPP | 2amt | e2amtD1 | D:1-156 |
| P62617 | DB02552 | GPP | 2amt | e2amtE1 | E:1-156 |
| P62617 | DB02552 | GPP | 2amt | e2amtF1 | F:1-156 |
| P62617 | DB02552 | GPP | 2gzl | e2gzlA1 | A:0-157 |
| P62617 | DB02552 | GPP | 3elc | e3elcA1 | A:0-156 |
| P62617 | DB02552 | GPP | 3elc | e3elcB1 | B:0-156 |
| P62617 | DB02552 | GPP | 3elc | e3elcC1 | C:0-156 |
| P62617 | DB02552 | GPP | 3eor | e3eorA1 | A:0-156 |
| P62617 | DB02552 | GPP | 3ern | e3ernA1 | A:0-156 |
| P62617 | DB02552 | GPP | 3ern | e3ernB1 | B:0-156 |
| P62617 | DB02552 | GPP | 3ern | e3ernC1 | C:0-156 |
| P62617 | DB02552 | GPP | 3ern | e3ernD1 | D:0-156 |
| P62617 | DB02552 | GPP | 3ern | e3ernE1 | E:0-156 |
| P62617 | DB02552 | GPP | 3ern | e3ernF1 | F:0-156 |
| P62617 | DB02552 | GPP | 3esj | e3esjA1 | A:-2-159 |
| P62617 | DB02552 | GPP | 3fba | e3fbaA1 | A:-1-156 |