Attributes
UniProt ID
Protein Name
4-hydroxy-3-methylbut-2-enyl diphosphate reductase -butenyl 4-diphosphate reductase
Ligand Name
(2E)-4-hydroxy-3-methylbut-2-en-1-yl trihydrogen diphosphate
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
MDSIZRKJVDMQOQ-GORDUTHDSA-N
SMILES
CC(=CCOP(=O)(O)OP(=O)(O)O)CO
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3SZL
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3szlA1e3szlA2e3szlA3e3szlB1e3szlB2e3szlB3
ECOD domains from experimental PDB structures interacting with ligand H6P
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P62623 | n/a | H6P | 3szl | e3szlA1 | A:1-95 |
| P62623 | n/a | H6P | 3szl | e3szlA2 | A:96-195 |
| P62623 | n/a | H6P | 3szl | e3szlA3 | A:196-309 |
| P62623 | n/a | H6P | 3szl | e3szlB1 | B:1-95 |
| P62623 | n/a | H6P | 3szl | e3szlB2 | B:96-195 |
| P62623 | n/a | H6P | 3szl | e3szlB3 | B:196-310 |
| P62623 | n/a | H6P | 3szo | e3szoA1 | A:1-95 |
| P62623 | n/a | H6P | 3szo | e3szoA2 | A:96-195 |
| P62623 | n/a | H6P | 3szo | e3szoA3 | A:196-309 |
| P62623 | n/a | H6P | 3szo | e3szoB1 | B:1-95 |
| P62623 | n/a | H6P | 3szo | e3szoB2 | B:96-195 |
| P62623 | n/a | H6P | 3szo | e3szoB3 | B:196-310 |
| P62623 | n/a | H6P | 3szu | e3szuA1 | A:1-95 |
| P62623 | n/a | H6P | 3szu | e3szuA2 | A:96-195 |
| P62623 | n/a | H6P | 3szu | e3szuA3 | A:196-309 |
| P62623 | n/a | H6P | 3szu | e3szuB1 | B:1-95 |
| P62623 | n/a | H6P | 3szu | e3szuB2 | B:96-195 |
| P62623 | n/a | H6P | 3szu | e3szuB3 | B:196-310 |
| P62623 | n/a | H6P | 3t0f | e3t0fA1 | A:-5-95 |
| P62623 | n/a | H6P | 3t0f | e3t0fA2 | A:96-195 |
| P62623 | n/a | H6P | 3t0f | e3t0fA3 | A:196-309 |
| P62623 | n/a | H6P | 3t0f | e3t0fB1 | B:-6-95 |
| P62623 | n/a | H6P | 3t0f | e3t0fB2 | B:96-195 |
| P62623 | n/a | H6P | 3t0f | e3t0fB3 | B:196-309 |
| P62623 | n/a | H6P | 3t0g | e3t0gA1 | A:1-95 |
| P62623 | n/a | H6P | 3t0g | e3t0gA2 | A:96-195 |
| P62623 | n/a | H6P | 3t0g | e3t0gA3 | A:196-309 |
| P62623 | n/a | H6P | 3t0g | e3t0gB1 | B:1-95 |
| P62623 | n/a | H6P | 3t0g | e3t0gB2 | B:96-195 |
| P62623 | n/a | H6P | 3t0g | e3t0gB3 | B:196-310 |