Attributes
UniProt ID
Protein Name
Ras-related protein Rab-1A
Ligand Name
GUANOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QGWNDRXFNXRZMB-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2FOL
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2folA1
ECOD domains from experimental PDB structures interacting with ligand DB04315
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P62820 | DB04315 | GDP | 2fol | e2folA1 | A:5-172 |
| P62820 | DB04315 | GDP | 3sfv | e3sfvA1 | A:-2-176 |
| P62820 | DB04315 | GDP | 4fmb | e4fmbB1 | B:6-176 |
| P62820 | DB04315 | GDP | 4fmb | e4fmbD1 | D:6-166 |
| P62820 | DB04315 | GDP | 4fmb | e4fmbF1 | F:6-166 |
| P62820 | DB04315 | GDP | 4fmc | e4fmcB1 | B:6-166 |
| P62820 | DB04315 | GDP | 4fmc | e4fmcD1 | D:6-166 |
| P62820 | DB04315 | GDP | 4fmc | e4fmcF1 | F:14-130 |
| P62820 | DB04315 | GDP | 4fmd | e4fmdB1 | B:6-166 |
| P62820 | DB04315 | GDP | 4fmd | e4fmdD1 | D:6-166 |
| P62820 | DB04315 | GDP | 4fmd | e4fmdF2 | F:13-176 |
| P62820 | DB04315 | GDP | 4fme | e4fmeB1 | B:6-166 |
| P62820 | DB04315 | GDP | 4fme | e4fmeE1 | E:6-166 |
| P62820 | DB04315 | GDP | 4iru | e4iruB1 | B:7-176 |
| P62820 | DB04315 | GDP | 4iru | e4iruD1 | D:7-176 |
| P62820 | DB04315 | GDP | 4iru | e4iruF1 | F:7-176 |
| P62820 | DB04315 | GDP | 4jvs | e4jvsB1 | B:7-176 |
| P62820 | DB04315 | GDP | 7eq2 | e7eq2A1 | A:7-178 |
| P62820 | DB04315 | GDP | 7eq2 | e7eq2B1 | B:5-178 |