Attributes
UniProt ID
Protein Name
Ras-related C3 botulinum toxin substrate 1
Ligand Name
GUANOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QGWNDRXFNXRZMB-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1G4U
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1g4uR1e1g4uS1e1g4uS2
ECOD domains from experimental PDB structures interacting with ligand DB04315
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P63000 | DB04315 | GDP | 1g4u | e1g4uR1 | R:1-180 |
| P63000 | DB04315 | GDP | 1i4d | e1i4dD1 | D:2-178 |
| P63000 | DB04315 | GDP | 1i4l | e1i4lD1 | D:2-178 |
| P63000 | DB04315 | GDP | 1ryf | e1ryfA1 | A:1A-59,A:93-200 |
| P63000 | DB04315 | GDP | 1ryf | e1ryfB1 | B:1A-58,B:93-199 |
| P63000 | DB04315 | GDP | 2h7v | e2h7vA1 | A:2-178 |
| P63000 | DB04315 | GDP | 2h7v | e2h7vB1 | B:2-178 |
| P63000 | DB04315 | GDP | 2p2l | e2p2lA1 | A:2-178 |
| P63000 | DB04315 | GDP | 2p2l | e2p2lB1 | B:2-178 |
| P63000 | DB04315 | GDP | 2p2l | e2p2lC1 | C:2-178 |
| P63000 | DB04315 | GDP | 5n6o | e5n6oA1 | A:2-177 |
| P63000 | DB04315 | GDP | 5n6o | e5n6oB1 | B:2-177 |
| P63000 | DB04315 | GDP | 5o33 | e5o33A1 | A:1-177 |
| P63000 | DB04315 | GDP | 6agp | e6agpA1 | A:1-181 |