Attributes
UniProt ID
Protein Name
Stathmin-4
Ligand Name
2-(N-MORPHOLINO)-ETHANESULFONIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SXGZJKUKBWWHRA-UHFFFAOYSA-N
SMILES
C1COCC[NH+]1CCS(=O)(=O)[O-]
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4I4T
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4i4tA3e4i4tA4e4i4tB3e4i4tB4e4i4tC3e4i4tC4e4i4tD1e4i4tD2e4i4tE2e4i4tF3
ECOD domains from experimental PDB structures interacting with ligand DB03814
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P63043 | DB03814 | MES | 4i4t | e4i4tE2 | E:6-143 |
| P63043 | DB03814 | MES | 4i50 | e4i50E2 | E:6-143 |
| P63043 | DB03814 | MES | 4iij | e4iijE1 | E:6-143 |
| P63043 | DB03814 | MES | 5ca1 | e5ca1E1 | E:6-141 |
| P63043 | DB03814 | MES | 5cb4 | e5cb4E1 | E:6-141 |
| P63043 | DB03814 | MES | 5j2t | e5j2tE1 | E:6-140 |
| P63043 | DB03814 | MES | 5m8g | e5m8gE1 | E:6-143 |
| P63043 | DB03814 | MES | 5mf4 | e5mf4E1 | E:6-142 |
| P63043 | DB03814 | MES | 5yz3 | e5yz3E1 | E:6-141 |
| P63043 | DB03814 | MES | 6f7c | e6f7cE1 | E:7-140 |
| P63043 | DB03814 | MES | 6gf3 | e6gf3E1 | E:6-141 |
| P63043 | DB03814 | MES | 6gj4 | e6gj4E1 | E:6-140 |
| P63043 | DB03814 | MES | 6gze | e6gzeE1 | E:8-139 |
| P63043 | DB03814 | MES | 6k9v | e6k9vE1 | E:6-141 |
| P63043 | DB03814 | MES | 7ce8 | e7ce8E1 | E:6-141 |
| P63043 | DB03814 | MES | 7cld | e7cldE1 | E:6-143 |
| P63043 | DB03814 | MES | 7e4p | e7e4pE1 | E:6-141 |
| P63043 | DB03814 | MES | 7e4q | e7e4qE1 | E:6-143 |
| P63043 | DB03814 | MES | 7e4r | e7e4rE1 | E:6-141 |
| P63043 | DB03814 | MES | 7e4y | e7e4yE1 | E:6-143 |
| P63043 | DB03814 | MES | 7e4z | e7e4zE1 | E:6-143 |
| P63043 | DB03814 | MES | 7emj | e7emjE1 | E:6-143 |
| P63043 | DB03814 | MES | 7ogn | e7ognE1 | E:50-185 |
| P63043 | DB03814 | MES | 7z2p | e7z2pE1 | E:6-143 |