Attributes
UniProt ID
Protein Name
Guanine nucleotide-binding protein G subunit alpha isoforms short
Ligand Name
GUANOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QGWNDRXFNXRZMB-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5G53
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5g53A1e5g53B1e5g53C1e5g53D1
ECOD domains from experimental PDB structures interacting with ligand DB04315
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P63092 | DB04315 | GDP | 5g53 | e5g53C1 | C:40-61,C:208-394 |
| P63092 | DB04315 | GDP | 6au6 | e6au6A1 | A:38-67,A:205-394 |
| P63092 | DB04315 | GDP | 6au6 | e6au6A2 | A:68-204 |
| P63092 | DB04315 | GDP | 6eg8 | e6eg8I1 | I:68-204 |
| P63092 | DB04315 | GDP | 6eg8 | e6eg8I2 | I:9-67,I:205-394 |
| P63092 | DB04315 | GDP | 6eg8 | e6eg8J1 | J:68-204 |
| P63092 | DB04315 | GDP | 6eg8 | e6eg8J2 | J:10-67,J:205-394 |
| P63092 | DB04315 | GDP | 6eg8 | e6eg8K1 | K:68-204 |
| P63092 | DB04315 | GDP | 6eg8 | e6eg8K2 | K:10-67,K:205-394 |
| P63092 | DB04315 | GDP | 6eg8 | e6eg8L1 | L:11-67,L:205-394 |
| P63092 | DB04315 | GDP | 6eg8 | e6eg8L2 | L:68-204 |
| P63092 | DB04315 | GDP | 7e5e | e7e5eA1 | A:68-204 |
| P63092 | DB04315 | GDP | 7e5e | e7e5eA2 | A:38-67,A:205-394 |
| P63092 | DB04315 | GDP | 7e5e | e7e5eB1 | B:39-67,B:205-387 |
| P63092 | DB04315 | GDP | 7e5e | e7e5eB2 | B:68-204 |
| P63092 | DB04315 | GDP | 7e5e | e7e5eC1 | C:68-204 |
| P63092 | DB04315 | GDP | 7e5e | e7e5eC2 | C:38-67,C:205-391 |
| P63092 | DB04315 | GDP | 7e5e | e7e5eD1 | D:39-67,D:205-384 |
| P63092 | DB04315 | GDP | 7e5e | e7e5eD2 | D:82-204 |
| P63092 | DB04315 | GDP | 7f1o | e7f1oA1 | A:39-394 |
| P63092 | DB04315 | GDP | 7f1z | e7f1zA1 | A:39-394 |