Attributes
UniProt ID
Protein Name
Actin, cytoplasmic 2
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5JLH
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5jlhA1e5jlhA2e5jlhB1e5jlhB2e5jlhC1e5jlhC2e5jlhD1e5jlhD2e5jlhE1e5jlhE2e5jlhF1e5jlhF2e5jlhG1e5jlhG2
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P63261 | DB16833 | ADP | 5jlh | e5jlhA1 | A:146-374 |
| P63261 | DB16833 | ADP | 5jlh | e5jlhA2 | A:1-145 |
| P63261 | DB16833 | ADP | 5jlh | e5jlhB1 | B:1-145 |
| P63261 | DB16833 | ADP | 5jlh | e5jlhB2 | B:146-374 |
| P63261 | DB16833 | ADP | 5jlh | e5jlhC1 | C:146-374 |
| P63261 | DB16833 | ADP | 5jlh | e5jlhC2 | C:1-145 |
| P63261 | DB16833 | ADP | 5jlh | e5jlhD1 | D:1-145 |
| P63261 | DB16833 | ADP | 5jlh | e5jlhD2 | D:146-374 |
| P63261 | DB16833 | ADP | 5jlh | e5jlhE1 | E:146-374 |
| P63261 | DB16833 | ADP | 5jlh | e5jlhE2 | E:1-145 |
| P63261 | DB16833 | ADP | 8dnf | e8dnfA1 | A:0-145 |
| P63261 | DB16833 | ADP | 8dnf | e8dnfA2 | A:146-374 |
| P63261 | DB16833 | ADP | 8dnf | e8dnfB1 | B:146-374 |
| P63261 | DB16833 | ADP | 8dnf | e8dnfB2 | B:0-145 |
| P63261 | DB16833 | ADP | 8dnf | e8dnfC1 | C:0-145 |
| P63261 | DB16833 | ADP | 8dnf | e8dnfC2 | C:146-374 |
| P63261 | DB16833 | ADP | 8dnf | e8dnfD1 | D:0-145 |
| P63261 | DB16833 | ADP | 8dnf | e8dnfD2 | D:146-374 |