Attributes
UniProt ID
Protein Name
n/a
Ligand Name
THIOLACTOMYCIN
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SYQNUQSGEWNWKV-XUIVZRPNSA-N
SMILES
CC1=C(C(SC1=O)(C)C=C(C)C=C)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2WGE
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2wgeA1e2wgeA2
ECOD domains from experimental PDB structures interacting with ligand DB04302
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P63454 | DB04302 | TLM | 2wge | e2wgeA1 | A:2-259 |
| P63454 | DB04302 | TLM | 2wge | e2wgeA2 | A:260-416 |
| P63454 | DB04302 | TLM | 2wgg | e2wggA1 | A:2-259 |
| P63454 | DB04302 | TLM | 2wgg | e2wggA2 | A:260-416 |
| P63454 | DB04302 | TLM | 2wgg | e2wggB1 | B:2-259 |
| P63454 | DB04302 | TLM | 2wgg | e2wggB2 | B:260-416 |
| P63454 | DB04302 | TLM | 2wgg | e2wggC1 | C:2-259 |
| P63454 | DB04302 | TLM | 2wgg | e2wggC2 | C:260-416 |
| P63454 | DB04302 | TLM | 2wgg | e2wggD1 | D:2-259 |
| P63454 | DB04302 | TLM | 2wgg | e2wggD2 | D:260-416 |
| P63454 | DB04302 | TLM | 2wgg | e2wggE1 | E:2-259 |
| P63454 | DB04302 | TLM | 2wgg | e2wggE2 | E:260-416 |
| P63454 | DB04302 | TLM | 2wgg | e2wggF1 | F:2-259 |
| P63454 | DB04302 | TLM | 2wgg | e2wggF2 | F:260-416 |
| P63454 | DB04302 | TLM | 2wgg | e2wggG1 | G:2-259 |
| P63454 | DB04302 | TLM | 2wgg | e2wggG2 | G:260-416 |
| P63454 | DB04302 | TLM | 2wgg | e2wggH1 | H:2-259 |
| P63454 | DB04302 | TLM | 2wgg | e2wggH2 | H:260-416 |