Attributes
UniProt ID
Protein Name
n/a
Ligand Name
URIDINE-5'-DIPHOSPHATE-N-ACETYLMURAMOYL-L-ALANINE-D-GLUTAMATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OJZCATPXPWFLHF-HPUCEMLMSA-N
SMILES
CC(C(=O)NC(CCC(=O)O)C(=O)O)NC(=O)C(C)OC1C(C(OC(C1O)CO)OP(=O)(O)OP(=O)(O)OCC2C(C(C(O2)N3C=CC(=O)NC3=O)O)O)NC(=O)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2WTZ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2wtzA1e2wtzA2e2wtzA3e2wtzB7e2wtzB8e2wtzB9e2wtzC1e2wtzC2e2wtzC3e2wtzD4e2wtzD5e2wtzD6
ECOD domains from experimental PDB structures interacting with ligand DB02314
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P65477 | DB02314 | UAG | 2wtz | e2wtzA2 | A:141-373 |
| P65477 | DB02314 | UAG | 2wtz | e2wtzA3 | A:26-140 |
| P65477 | DB02314 | UAG | 2wtz | e2wtzB8 | B:142-373 |
| P65477 | DB02314 | UAG | 2wtz | e2wtzB9 | B:26-141 |
| P65477 | DB02314 | UAG | 2wtz | e2wtzC2 | C:142-373 |
| P65477 | DB02314 | UAG | 2wtz | e2wtzC3 | C:24-141 |
| P65477 | DB02314 | UAG | 2wtz | e2wtzD5 | D:142-373 |
| P65477 | DB02314 | UAG | 2wtz | e2wtzD6 | D:26-141 |
| P65477 | DB02314 | UAG | 2xja | e2xjaA3 | A:374-532 |
| P65477 | DB02314 | UAG | 2xja | e2xjaA4 | A:142-373 |
| P65477 | DB02314 | UAG | 2xja | e2xjaA5 | A:26-141 |
| P65477 | DB02314 | UAG | 2xja | e2xjaB2 | B:374-532 |
| P65477 | DB02314 | UAG | 2xja | e2xjaB4 | B:142-373 |
| P65477 | DB02314 | UAG | 2xja | e2xjaB5 | B:27-141 |
| P65477 | DB02314 | UAG | 2xja | e2xjaC2 | C:374-532 |
| P65477 | DB02314 | UAG | 2xja | e2xjaC4 | C:142-373 |
| P65477 | DB02314 | UAG | 2xja | e2xjaC5 | C:27-141 |
| P65477 | DB02314 | UAG | 2xja | e2xjaD4 | D:142-373 |
| P65477 | DB02314 | UAG | 2xja | e2xjaD5 | D:27-141 |