Attributes
UniProt ID
Protein Name
n/a
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2AF6
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2af6A1e2af6B1e2af6C1e2af6D1e2af6E1e2af6F1e2af6G1e2af6H1
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P66930 | DB03147 | FAD | 2af6 | e2af6A1 | A:3-247 |
| P66930 | DB03147 | FAD | 2af6 | e2af6B1 | B:3-247 |
| P66930 | DB03147 | FAD | 2af6 | e2af6C1 | C:3-244 |
| P66930 | DB03147 | FAD | 2af6 | e2af6D1 | D:3-244 |
| P66930 | DB03147 | FAD | 2af6 | e2af6E1 | E:3-245 |
| P66930 | DB03147 | FAD | 2af6 | e2af6F1 | F:3-244 |
| P66930 | DB03147 | FAD | 2af6 | e2af6G1 | G:3-248 |
| P66930 | DB03147 | FAD | 2af6 | e2af6H1 | H:3-245 |
| P66930 | DB03147 | FAD | 3gwc | e3gwcA1 | A:2-247 |
| P66930 | DB03147 | FAD | 3gwc | e3gwcB1 | B:2-244 |
| P66930 | DB03147 | FAD | 3gwc | e3gwcC1 | C:2-244 |
| P66930 | DB03147 | FAD | 3gwc | e3gwcD1 | D:3-244 |
| P66930 | DB03147 | FAD | 3gwc | e3gwcE1 | E:2-245 |
| P66930 | DB03147 | FAD | 3gwc | e3gwcF1 | F:3-244 |
| P66930 | DB03147 | FAD | 3gwc | e3gwcG1 | G:3-247 |
| P66930 | DB03147 | FAD | 3gwc | e3gwcH1 | H:3-245 |
| P66930 | DB03147 | FAD | 3hzg | e3hzgA1 | A:2-246 |
| P66930 | DB03147 | FAD | 3hzg | e3hzgB1 | B:2-244 |
| P66930 | DB03147 | FAD | 3hzg | e3hzgC1 | C:2-246 |
| P66930 | DB03147 | FAD | 3hzg | e3hzgD1 | D:2-246 |