Attributes
UniProt ID
Protein Name
Actin, alpha skeletal muscle
Ligand Name
~{N}-[4-[(4~{R},7~{R},10~{S},13~{S},15~{E},19~{S})-4-(4-hydroxyphenyl)-7-(1~{H}-indol-3-ylmethyl)-8,13,15,19-tetramethyl-2,6,9,12-tetrakis(oxidanylidene)-1-oxa-5,8,11-triazacyclononadec-15-en-10-yl]butyl]-~{N}'-[5-methoxy-2-[(~{Z})-(3,4,5-trimethoxyphenyl)diazenyl]phenyl]butanediamide
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NHSDRYIAMSCFAB-MHSPIPMPSA-N
SMILES
CC1CCC=C(CC(C(=O)NC(C(=O)N(C(C(=O)NC(CC(=O)O1)c2ccc(cc2)O)Cc3c[nH]c4c3cccc4)C)CCCCNC(=O)CCC(=O)Nc5cc(ccc5N=Nc6cc(c(c(c6)OC)OC)OC)OC)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7AHN
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7ahnA1e7ahnA2e7ahnB1e7ahnB2e7ahnC1e7ahnC2e7ahnD1e7ahnD2e7ahnE1e7ahnE2
ECOD domains from experimental PDB structures interacting with ligand RLZ
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P68135 | n/a | RLZ | 7ahn | e7ahnA1 | A:5-139 |
| P68135 | n/a | RLZ | 7ahn | e7ahnA2 | A:140-375 |
| P68135 | n/a | RLZ | 7ahn | e7ahnB1 | B:5-139 |
| P68135 | n/a | RLZ | 7ahn | e7ahnB2 | B:140-375 |
| P68135 | n/a | RLZ | 7ahn | e7ahnC1 | C:5-139 |
| P68135 | n/a | RLZ | 7ahn | e7ahnC2 | C:140-375 |
| P68135 | n/a | RLZ | 7ahn | e7ahnD1 | D:140-375 |
| P68135 | n/a | RLZ | 7ahn | e7ahnD2 | D:5-139 |
| P68135 | n/a | RLZ | 7ahn | e7ahnE1 | E:140-375 |
| P68135 | n/a | RLZ | 7ahn | e7ahnE2 | E:5-139 |
| P68135 | n/a | RLZ | 7ahq | e7ahqA1 | A:140-375 |
| P68135 | n/a | RLZ | 7ahq | e7ahqA2 | A:5-139 |
| P68135 | n/a | RLZ | 7ahq | e7ahqB1 | B:5-139 |
| P68135 | n/a | RLZ | 7ahq | e7ahqB2 | B:140-375 |
| P68135 | n/a | RLZ | 7ahq | e7ahqC1 | C:140-375 |
| P68135 | n/a | RLZ | 7ahq | e7ahqD1 | D:140-375 |
| P68135 | n/a | RLZ | 7ahq | e7ahqD2 | D:5-139 |
| P68135 | n/a | RLZ | 7ahq | e7ahqE1 | E:5-139 |
| P68135 | n/a | RLZ | 7ahq | e7ahqE2 | E:140-375 |