Attributes
UniProt ID
Protein Name
Tubulin alpha-1B chain
Ligand Name
Cryptophycin 1
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
PSNOPSMXOBPNNV-XUMGCJJFSA-N
SMILES
CC1CNC(=O)C(NC(=O)C=CCC(OC(=O)C(OC1=O)CC(C)C)C(C)C2C(O2)c3ccccc3)Cc4ccc(c(c4)Cl)OC
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7M18
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7m18A1e7m18A2e7m18B1e7m18B2e7m18C1e7m18C2e7m18D1e7m18D2e7m18E1e7m18E2e7m18F1e7m18F2e7m18G1e7m18G2e7m18H1e7m18H2e7m18I1e7m18I2e7m18J1e7m18J2e7m18K1e7m18K2e7m18L1e7m18L2e7m18M1e7m18M2e7m18N1e7m18N2e7m18O1e7m18O2e7m18P1e7m18P2
ECOD domains from experimental PDB structures interacting with ligand YNP
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P68363 | n/a | YNP | 7m18 | e7m18A2 | A:246-436 |
| P68363 | n/a | YNP | 7m18 | e7m18C2 | C:246-436 |
| P68363 | n/a | YNP | 7m18 | e7m18E2 | E:246-436 |
| P68363 | n/a | YNP | 7m18 | e7m18G2 | G:246-436 |
| P68363 | n/a | YNP | 7m18 | e7m18I2 | I:246-436 |
| P68363 | n/a | YNP | 7m18 | e7m18K2 | K:246-436 |
| P68363 | n/a | YNP | 7m18 | e7m18M2 | M:246-436 |
| P68363 | n/a | YNP | 7m18 | e7m18O2 | O:246-436 |
| P68363 | n/a | YNP | 7m20 | e7m20A1 | A:1-245 |
| P68363 | n/a | YNP | 7m20 | e7m20A2 | A:246-436 |
| P68363 | n/a | YNP | 7m20 | e7m20C2 | C:246-436 |
| P68363 | n/a | YNP | 7m20 | e7m20E2 | E:246-436 |
| P68363 | n/a | YNP | 7m20 | e7m20G2 | G:246-436 |
| P68363 | n/a | YNP | 7m20 | e7m20I2 | I:246-436 |
| P68363 | n/a | YNP | 7m20 | e7m20K2 | K:246-436 |
| P68363 | n/a | YNP | 7m20 | e7m20M2 | M:246-436 |
| P68363 | n/a | YNP | 7m20 | e7m20O2 | O:246-436 |
| P68363 | n/a | YNP | 7m20 | e7m20Q2 | Q:246-436 |