Attributes
UniProt ID
Protein Name
Casein kinase II subunit alpha
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5CSH
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5cshA1e5cshB1
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P68400 | DB00171 | ATP | 5csh | e5cshA1 | A:4-327 |
| P68400 | DB00171 | ATP | 5csh | e5cshB1 | B:2-328 |
| P68400 | DB00171 | ATP | 5cu6 | e5cu6A1 | A:3-329 |
| P68400 | DB00171 | ATP | 5cvf | e5cvfA1 | A:3-329 |
| P68400 | DB00171 | ATP | 5os7 | e5os7A1 | A:3-328 |
| P68400 | DB00171 | ATP | 5os7 | e5os7B1 | B:3-327 |
| P68400 | DB00171 | ATP | 5os8 | e5os8A1 | A:3-329 |
| P68400 | DB00171 | ATP | 5osp | e5ospA1 | A:3-329 |
| P68400 | DB00171 | ATP | 5osr | e5osrA1 | A:3-329 |
| P68400 | DB00171 | ATP | 5otr | e5otrA1 | A:3-329 |
| P68400 | DB00171 | ATP | 6fvf | e6fvfA1 | A:3-329 |
| P68400 | DB00171 | ATP | 6fvg | e6fvgA1 | A:3-329 |
| P68400 | DB00171 | ATP | 6gmd | e6gmdA1 | A:3-327 |
| P68400 | DB00171 | ATP | 6gmd | e6gmdB1 | B:3-328 |
| P68400 | DB00171 | ATP | 7zy2 | e7zy2A1 | A:3-329 |
| P68400 | DB00171 | ATP | 7zyd | e7zydA1 | A:3-329 |
| P68400 | DB00171 | ATP | 7zyo | e7zyoA1 | A:3-329 |
| P68400 | DB00171 | ATP | 7zyr | e7zyrA1 | A:3-329 |
| P68400 | DB00171 | ATP | 8aec | e8aecA1 | A:3-329 |
| P68400 | DB00171 | ATP | 8aek | e8aekA1 | A:3-329 |
| P68400 | DB00171 | ATP | 8aem | e8aemA1 | A:3-329 |