Attributes
UniProt ID
Protein Name
Adenosylhomocysteinase
Ligand Name
ADENOSINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OIRDTQYFTABQOQ-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)CO)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7O5L
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7o5lA1e7o5lA2e7o5lC1e7o5lC2
ECOD domains from experimental PDB structures interacting with ligand DB00640
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P74008 | DB00640 | ADN | 7o5l | e7o5lA1 | A:185-350 |
| P74008 | DB00640 | ADN | 7o5l | e7o5lA2 | A:9-187,A:351-425 |
| P74008 | DB00640 | ADN | 7o5l | e7o5lC1 | C:9-187,C:351-421 |
| P74008 | DB00640 | ADN | 7o5l | e7o5lC2 | C:185-350 |
| P74008 | DB00640 | ADN | 7o5m | e7o5mA1 | A:185-350 |
| P74008 | DB00640 | ADN | 7o5m | e7o5mA2 | A:9-187,A:351-422 |
| P74008 | DB00640 | ADN | 7zd7 | e7zd7A1 | A:9-187,A:351-422 |
| P74008 | DB00640 | ADN | 7zd7 | e7zd7A2 | A:185-350 |
| P74008 | DB00640 | ADN | 7zd7 | e7zd7C1 | C:185-350 |
| P74008 | DB00640 | ADN | 7zd7 | e7zd7C2 | C:9-187,C:351-422 |
| P74008 | DB00640 | ADN | 7zd8 | e7zd8A1 | A:9-187,A:351-425 |
| P74008 | DB00640 | ADN | 7zd8 | e7zd8A2 | A:185-350 |
| P74008 | DB00640 | ADN | 7zd8 | e7zd8C1 | C:185-350 |
| P74008 | DB00640 | ADN | 7zd8 | e7zd8C2 | C:9-187,C:351-422 |
| P74008 | DB00640 | ADN | 7zd9 | e7zd9A1 | A:185-350 |
| P74008 | DB00640 | ADN | 7zd9 | e7zd9A2 | A:9-187,A:351-425 |
| P74008 | DB00640 | ADN | 7zd9 | e7zd9C1 | C:185-350 |
| P74008 | DB00640 | ADN | 7zd9 | e7zd9C2 | C:9-187,C:351-425 |