Attributes
UniProt ID
Protein Name
Ribosomal protein S12 methylthiotransferase accessory factor YcaO
Ligand Name
ADENOSINE MONOPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
UDMBCSSLTHHNCD-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4Q86
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4q86A1e4q86A2e4q86A3e4q86A4e4q86B1e4q86B2e4q86B3e4q86B4e4q86C1e4q86C2e4q86C3e4q86C4e4q86D1e4q86D2e4q86D3e4q86D4e4q86E1e4q86E2e4q86E3e4q86E4e4q86F1e4q86F2e4q86F3e4q86F4e4q86G1e4q86G2e4q86G3e4q86G4e4q86H1e4q86H2e4q86H3e4q86H4
ECOD domains from experimental PDB structures interacting with ligand DB00131
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P75838 | DB00131 | AMP | 4q86 | e4q86A2 | A:214-346 |
| P75838 | DB00131 | AMP | 4q86 | e4q86A3 | A:104-213,A:347-406 |
| P75838 | DB00131 | AMP | 4q86 | e4q86A4 | A:2-103 |
| P75838 | DB00131 | AMP | 4q86 | e4q86B2 | B:214-346 |
| P75838 | DB00131 | AMP | 4q86 | e4q86B3 | B:104-213,B:347-406 |
| P75838 | DB00131 | AMP | 4q86 | e4q86B4 | B:2-103 |
| P75838 | DB00131 | AMP | 4q86 | e4q86C2 | C:214-346 |
| P75838 | DB00131 | AMP | 4q86 | e4q86C3 | C:104-213,C:347-406 |
| P75838 | DB00131 | AMP | 4q86 | e4q86C4 | C:12-103 |
| P75838 | DB00131 | AMP | 4q86 | e4q86D2 | D:214-346 |
| P75838 | DB00131 | AMP | 4q86 | e4q86D3 | D:104-213,D:347-406 |
| P75838 | DB00131 | AMP | 4q86 | e4q86D4 | D:2-103 |
| P75838 | DB00131 | AMP | 4q86 | e4q86E2 | E:214-346 |
| P75838 | DB00131 | AMP | 4q86 | e4q86E3 | E:104-213,E:347-406 |
| P75838 | DB00131 | AMP | 4q86 | e4q86E4 | E:4-103 |
| P75838 | DB00131 | AMP | 4q86 | e4q86G2 | G:214-346 |
| P75838 | DB00131 | AMP | 4q86 | e4q86G3 | G:104-213,G:347-406 |
| P75838 | DB00131 | AMP | 4q86 | e4q86G4 | G:7-103 |
| P75838 | DB00131 | AMP | 4q86 | e4q86H2 | H:214-346 |
| P75838 | DB00131 | AMP | 4q86 | e4q86H3 | H:104-213,H:347-406 |
| P75838 | DB00131 | AMP | 4q86 | e4q86H4 | H:2-103 |