Attributes
UniProt ID
Protein Name
3-hydroxy-5-phosphonooxypentane-2,4-dione thiolase
Ligand Name
RIBULOSE-5-PHOSPHATE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
FNZLKVNUWIIPSJ-UHNVWZDZSA-N
SMILES
C(C(C(C(=O)CO)O)O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3GND
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3gndA1e3gndB1e3gndC1e3gndD1e3gndE1e3gndF1e3gndG1e3gndH1e3gndI1e3gndJ1e3gndK1e3gndL1e3gndM1e3gndN1e3gndO1e3gndP1e3gndQ1e3gndR1e3gndS1e3gndT1
ECOD domains from experimental PDB structures interacting with ligand 5RP
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P76143 | n/a | 5RP | 3gnd | e3gndA1 | A:10-289 |
| P76143 | n/a | 5RP | 3gnd | e3gndB1 | B:10-289 |
| P76143 | n/a | 5RP | 3gnd | e3gndC1 | C:10-289 |
| P76143 | n/a | 5RP | 3gnd | e3gndD1 | D:10-289 |
| P76143 | n/a | 5RP | 3gnd | e3gndE1 | E:10-289 |
| P76143 | n/a | 5RP | 3gnd | e3gndF1 | F:10-289 |
| P76143 | n/a | 5RP | 3gnd | e3gndG1 | G:10-289 |
| P76143 | n/a | 5RP | 3gnd | e3gndH1 | H:10-289 |
| P76143 | n/a | 5RP | 3gnd | e3gndI1 | I:10-289 |
| P76143 | n/a | 5RP | 3gnd | e3gndJ1 | J:10-289 |
| P76143 | n/a | 5RP | 3gnd | e3gndK1 | K:10-289 |
| P76143 | n/a | 5RP | 3gnd | e3gndL1 | L:10-289 |
| P76143 | n/a | 5RP | 3gnd | e3gndM1 | M:10-289 |
| P76143 | n/a | 5RP | 3gnd | e3gndN1 | N:10-289 |
| P76143 | n/a | 5RP | 3gnd | e3gndO1 | O:10-289 |
| P76143 | n/a | 5RP | 3gnd | e3gndP1 | P:10-289 |
| P76143 | n/a | 5RP | 3gnd | e3gndQ1 | Q:10-289 |
| P76143 | n/a | 5RP | 3gnd | e3gndR1 | R:10-289 |
| P76143 | n/a | 5RP | 3gnd | e3gndS1 | S:10-289 |
| P76143 | n/a | 5RP | 3gnd | e3gndT1 | T:10-289 |