Attributes
UniProt ID
Protein Name
Tyrosine-protein kinase wzc
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3LA6
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3la6A1e3la6B1e3la6C1e3la6D1e3la6E1e3la6F1e3la6G1e3la6H1e3la6I1e3la6J1e3la6K1e3la6L1e3la6M1e3la6N1e3la6O1e3la6P1
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P76387 | DB16833 | ADP | 3la6 | e3la6A1 | A:451-719 |
| P76387 | DB16833 | ADP | 3la6 | e3la6B1 | B:450-719 |
| P76387 | DB16833 | ADP | 3la6 | e3la6C1 | C:450-719 |
| P76387 | DB16833 | ADP | 3la6 | e3la6D1 | D:450-717 |
| P76387 | DB16833 | ADP | 3la6 | e3la6E1 | E:450-718 |
| P76387 | DB16833 | ADP | 3la6 | e3la6F1 | F:450-719 |
| P76387 | DB16833 | ADP | 3la6 | e3la6G1 | G:449-718 |
| P76387 | DB16833 | ADP | 3la6 | e3la6H1 | H:450-719 |
| P76387 | DB16833 | ADP | 3la6 | e3la6I1 | I:450-718 |
| P76387 | DB16833 | ADP | 3la6 | e3la6J1 | J:450-717 |
| P76387 | DB16833 | ADP | 3la6 | e3la6K1 | K:450-717 |
| P76387 | DB16833 | ADP | 3la6 | e3la6L1 | L:451-720 |
| P76387 | DB16833 | ADP | 3la6 | e3la6M1 | M:450-718 |
| P76387 | DB16833 | ADP | 3la6 | e3la6N1 | N:450-718 |
| P76387 | DB16833 | ADP | 3la6 | e3la6O1 | O:449-719 |
| P76387 | DB16833 | ADP | 3la6 | e3la6P1 | P:451-718 |