Attributes
UniProt ID
Protein Name
Bifunctional protein PaaZ
Ligand Name
NADP NICOTINAMIDE-ADENINE-DINUCLEOTIDE PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XJLXINKUBYWONI-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)OP(=O)(O)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6JQN
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6jqnA1e6jqnA2e6jqnA3e6jqnB1e6jqnB2e6jqnB3e6jqnC1e6jqnC2e6jqnC3e6jqnD1e6jqnD2e6jqnD3e6jqnE1e6jqnE2e6jqnE3e6jqnF1e6jqnF2e6jqnF3
ECOD domains from experimental PDB structures interacting with ligand DB03461
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P77455 | DB03461 | NAP | 6jqn | e6jqnA1 | A:2-258 |
| P77455 | DB03461 | NAP | 6jqn | e6jqnA2 | A:259-501 |
| P77455 | DB03461 | NAP | 6jqn | e6jqnB1 | B:2-258 |
| P77455 | DB03461 | NAP | 6jqn | e6jqnB2 | B:259-501 |
| P77455 | DB03461 | NAP | 6jqn | e6jqnC1 | C:2-258 |
| P77455 | DB03461 | NAP | 6jqn | e6jqnC2 | C:259-501 |
| P77455 | DB03461 | NAP | 6jqn | e6jqnD1 | D:2-258 |
| P77455 | DB03461 | NAP | 6jqn | e6jqnD2 | D:259-501 |
| P77455 | DB03461 | NAP | 6jqn | e6jqnE1 | E:2-258 |
| P77455 | DB03461 | NAP | 6jqn | e6jqnE2 | E:259-501 |
| P77455 | DB03461 | NAP | 6jqn | e6jqnF1 | F:2-258 |
| P77455 | DB03461 | NAP | 6jqn | e6jqnF2 | F:259-501 |
| P77455 | DB03461 | NAP | 6jqo | e6jqoA1 | A:2-258 |
| P77455 | DB03461 | NAP | 6jqo | e6jqoA2 | A:259-501 |
| P77455 | DB03461 | NAP | 6jqo | e6jqoB1 | B:2-258 |
| P77455 | DB03461 | NAP | 6jqo | e6jqoB2 | B:259-501 |
| P77455 | DB03461 | NAP | 6jqo | e6jqoC1 | C:2-258 |
| P77455 | DB03461 | NAP | 6jqo | e6jqoC2 | C:259-501 |
| P77455 | DB03461 | NAP | 6jqo | e6jqoD1 | D:2-258 |
| P77455 | DB03461 | NAP | 6jqo | e6jqoD2 | D:259-501 |
| P77455 | DB03461 | NAP | 6jqo | e6jqoE1 | E:2-258 |
| P77455 | DB03461 | NAP | 6jqo | e6jqoE2 | E:259-501 |
| P77455 | DB03461 | NAP | 6jqo | e6jqoF1 | F:2-258 |
| P77455 | DB03461 | NAP | 6jqo | e6jqoF2 | F:259-501 |