Attributes
UniProt ID
Protein Name
Double-stranded RNA-specific editase 1
Ligand Name
INOSITOL HEXAKISPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
IMQLKJBTEOYOSI-GPIVLXJGSA-N
SMILES
C1(C(C(C(C(C1OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1ZY7
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1zy7A1e1zy7B1
ECOD domains from experimental PDB structures interacting with ligand DB14981
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P78563 | DB14981 | IHP | 1zy7 | e1zy7A1 | A:299-676 |
| P78563 | DB14981 | IHP | 1zy7 | e1zy7B1 | B:306-700 |
| P78563 | DB14981 | IHP | 5ed1 | e5ed1A1 | A:305-700 |
| P78563 | DB14981 | IHP | 5ed1 | e5ed1D1 | D:304-700 |
| P78563 | DB14981 | IHP | 5ed2 | e5ed2A1 | A:316-700 |
| P78563 | DB14981 | IHP | 5ed2 | e5ed2D1 | D:316-700 |
| P78563 | DB14981 | IHP | 5hp2 | e5hp2A1 | A:305-700 |
| P78563 | DB14981 | IHP | 5hp2 | e5hp2D1 | D:304-700 |
| P78563 | DB14981 | IHP | 5hp3 | e5hp3A1 | A:307-700 |
| P78563 | DB14981 | IHP | 5hp3 | e5hp3D1 | D:304-700 |
| P78563 | DB14981 | IHP | 6d06 | e6d06A1 | A:317-700 |
| P78563 | DB14981 | IHP | 6d06 | e6d06D1 | D:319-700 |
| P78563 | DB14981 | IHP | 6vff | e6vffA1 | A:319-700 |
| P78563 | DB14981 | IHP | 6vff | e6vffB1 | B:302-700 |
| P78563 | DB14981 | IHP | 7kfn | e7kfnA1 | A:317-700 |
| P78563 | DB14981 | IHP | 7kfn | e7kfnD1 | D:318-700 |
| P78563 | DB14981 | IHP | 8e0f | e8e0fA1 | A:316-699 |
| P78563 | DB14981 | IHP | 8e0f | e8e0fB1 | B:302-700 |
| P78563 | DB14981 | IHP | 8e4x | e8e4xA1 | A:316-699 |
| P78563 | DB14981 | IHP | 8e4x | e8e4xB1 | B:302-700 |