Attributes
UniProt ID
Protein Name
4-aminobutyrate aminotransferase, mitochondrial -3-amino-2-methylpropionate transaminase
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1OHV
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1ohvA2e1ohvA3e1ohvB2e1ohvB3e1ohvC2e1ohvC3e1ohvD2e1ohvD3
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P80147 | DB00114 | PLP | 1ohv | e1ohvA2 | A:11-375 |
| P80147 | DB00114 | PLP | 1ohv | e1ohvB2 | B:11-375 |
| P80147 | DB00114 | PLP | 1ohv | e1ohvC2 | C:11-375 |
| P80147 | DB00114 | PLP | 1ohv | e1ohvD2 | D:11-375 |
| P80147 | DB00114 | PLP | 1ohw | e1ohwA2 | A:11-375 |
| P80147 | DB00114 | PLP | 1ohw | e1ohwB2 | B:11-375 |
| P80147 | DB00114 | PLP | 1ohw | e1ohwC2 | C:11-375 |
| P80147 | DB00114 | PLP | 1ohw | e1ohwD2 | D:11-375 |
| P80147 | DB00114 | PLP | 1ohy | e1ohyA2 | A:11-375 |
| P80147 | DB00114 | PLP | 1ohy | e1ohyB2 | B:11-375 |
| P80147 | DB00114 | PLP | 1ohy | e1ohyC2 | C:11-375 |
| P80147 | DB00114 | PLP | 1ohy | e1ohyD2 | D:11-375 |
| P80147 | DB00114 | PLP | 4y0h | e4y0hA2 | A:11-375 |
| P80147 | DB00114 | PLP | 4y0h | e4y0hB1 | B:11-375 |
| P80147 | DB00114 | PLP | 4y0h | e4y0hC2 | C:11-375 |
| P80147 | DB00114 | PLP | 4y0h | e4y0hD1 | D:10-375 |