Attributes
UniProt ID
Protein Name
4-aminobutyrate aminotransferase, mitochondrial -3-amino-2-methylpropionate transaminase
Ligand Name
(1S)-4-[({3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]pyridin-4-yl}methyl)amino]cyclopent-3-ene-1,3-dicarboxylic acid
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VNQKGJPXVHNUEY-QMMMGPOBSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)CNC2=C(CC(C2)C(=O)O)C(=O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4Y0D
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4y0dA1e4y0dA2e4y0dB1e4y0dB2e4y0dC1e4y0dC2e4y0dD1e4y0dD2
ECOD domains from experimental PDB structures interacting with ligand RW2
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P80147 | n/a | RW2 | 4y0d | e4y0dA1 | A:376-471 |
| P80147 | n/a | RW2 | 4y0d | e4y0dA2 | A:10-375 |
| P80147 | n/a | RW2 | 4y0d | e4y0dB1 | B:11-375 |
| P80147 | n/a | RW2 | 4y0d | e4y0dB2 | B:376-471 |
| P80147 | n/a | RW2 | 4y0d | e4y0dC1 | C:10-375 |
| P80147 | n/a | RW2 | 4y0d | e4y0dC2 | C:376-471 |
| P80147 | n/a | RW2 | 4y0d | e4y0dD1 | D:376-471 |
| P80147 | n/a | RW2 | 4y0d | e4y0dD2 | D:11-375 |
| P80147 | n/a | RW2 | 4zsw | e4zswA1 | A:11-375 |
| P80147 | n/a | RW2 | 4zsw | e4zswA2 | A:376-471 |
| P80147 | n/a | RW2 | 4zsw | e4zswB1 | B:11-375 |
| P80147 | n/a | RW2 | 4zsw | e4zswB2 | B:376-471 |
| P80147 | n/a | RW2 | 4zsw | e4zswC1 | C:376-471 |
| P80147 | n/a | RW2 | 4zsw | e4zswC2 | C:11-375 |
| P80147 | n/a | RW2 | 4zsw | e4zswD1 | D:376-471 |
| P80147 | n/a | RW2 | 4zsw | e4zswD2 | D:11-375 |
| P80147 | n/a | RW2 | 4zsy | e4zsyA1 | A:376-471 |
| P80147 | n/a | RW2 | 4zsy | e4zsyA2 | A:11-375 |
| P80147 | n/a | RW2 | 4zsy | e4zsyB1 | B:12-375 |
| P80147 | n/a | RW2 | 4zsy | e4zsyB2 | B:376-471 |
| P80147 | n/a | RW2 | 4zsy | e4zsyC1 | C:376-471 |
| P80147 | n/a | RW2 | 4zsy | e4zsyC2 | C:11-375 |
| P80147 | n/a | RW2 | 4zsy | e4zsyD1 | D:12-375 |
| P80147 | n/a | RW2 | 4zsy | e4zsyD2 | D:376-471 |