Attributes
UniProt ID
Protein Name
Neutrophil gelatinase-associated lipocalin
Ligand Name
N,N'-butane-1,4-diylbis[1-hydroxy-N-(3-{[(1-hydroxy-6-oxo-1,6-dihydropyridin-2-yl)carbonyl]amino}propyl)-6-oxo-1,6-dihydropyridine-2-carboxamide]
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
KUWKQASGHNTJAT-UHFFFAOYSA-N
SMILES
C1=CC(=O)N(C(=C1)C(=O)NCCCN(CCCCN(CCCNC(=O)C2=CC=CC(=O)N2O)C(=O)C3=CC=CC(=O)N3O)C(=O)C4=CC=CC(=O)N4O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4ZHF
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4zhfA1e4zhfB1e4zhfC1e4zhfD1e4zhfE1e4zhfF1
ECOD domains from experimental PDB structures interacting with ligand 4OL
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P80188 | n/a | 4OL | 4zhf | e4zhfA1 | A:2-178 |
| P80188 | n/a | 4OL | 4zhf | e4zhfB1 | B:3-177 |
| P80188 | n/a | 4OL | 4zhf | e4zhfC1 | C:3-177 |
| P80188 | n/a | 4OL | 4zhf | e4zhfD1 | D:2-178 |
| P80188 | n/a | 4OL | 4zhf | e4zhfE1 | E:2-177 |
| P80188 | n/a | 4OL | 4zhf | e4zhfF1 | F:3-177 |
| P80188 | n/a | 4OL | 4zhg | e4zhgA1 | A:2-178 |
| P80188 | n/a | 4OL | 4zhg | e4zhgB1 | B:3-177 |
| P80188 | n/a | 4OL | 4zhg | e4zhgC1 | C:3-177 |
| P80188 | n/a | 4OL | 4zhg | e4zhgD1 | D:2-178 |
| P80188 | n/a | 4OL | 4zhg | e4zhgE1 | E:2-177 |
| P80188 | n/a | 4OL | 4zhg | e4zhgF1 | F:3-177 |
| P80188 | n/a | 4OL | 4zhh | e4zhhA1 | A:2-178 |
| P80188 | n/a | 4OL | 4zhh | e4zhhB1 | B:3-177 |
| P80188 | n/a | 4OL | 4zhh | e4zhhC1 | C:3-177 |
| P80188 | n/a | 4OL | 4zhh | e4zhhD1 | D:2-177 |
| P80188 | n/a | 4OL | 4zhh | e4zhhE1 | E:2-177 |
| P80188 | n/a | 4OL | 4zhh | e4zhhF1 | F:3-177 |
| P80188 | n/a | 4OL | 5kic | e5kicA1 | A:5-177 |
| P80188 | n/a | 4OL | 5kic | e5kicB1 | B:3-177 |
| P80188 | n/a | 4OL | 5kic | e5kicC1 | C:3-177 |