Attributes
UniProt ID
Protein Name
NADH-cytochrome b5 reductase 3
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1NDH
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1ndhA1e1ndhA2
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P83686 | DB03147 | FAD | 1ndh | e1ndhA1 | A:3-125 |
| P83686 | DB03147 | FAD | 1ndh | e1ndhA2 | A:126-272 |
| P83686 | DB03147 | FAD | 3w2e | e3w2eA1 | A:2-125 |
| P83686 | DB03147 | FAD | 3w2e | e3w2eA2 | A:126-272 |
| P83686 | DB03147 | FAD | 3w2f | e3w2fA1 | A:2-125 |
| P83686 | DB03147 | FAD | 3w2f | e3w2fA2 | A:126-272 |
| P83686 | DB03147 | FAD | 3w2g | e3w2gA1 | A:2-125 |
| P83686 | DB03147 | FAD | 3w2g | e3w2gA2 | A:126-272 |
| P83686 | DB03147 | FAD | 3w2h | e3w2hA1 | A:2-125 |
| P83686 | DB03147 | FAD | 3w2h | e3w2hA2 | A:126-272 |
| P83686 | DB03147 | FAD | 3w2i | e3w2iA1 | A:2-125 |
| P83686 | DB03147 | FAD | 3w2i | e3w2iA2 | A:126-272 |
| P83686 | DB03147 | FAD | 3w5h | e3w5hA1 | A:1001-1125 |
| P83686 | DB03147 | FAD | 3w5h | e3w5hA2 | A:1126-1272 |
| P83686 | DB03147 | FAD | 5gv7 | e5gv7A1 | A:1001-1125 |
| P83686 | DB03147 | FAD | 5gv7 | e5gv7A2 | A:1126-1272 |
| P83686 | DB03147 | FAD | 5gv8 | e5gv8A1 | A:1126-1272 |
| P83686 | DB03147 | FAD | 5gv8 | e5gv8A2 | A:1001-1125 |