Attributes
UniProt ID
Protein Name
Succinate dehydrogenase cytochrome b large subunit, mitochondrial
Ligand Name
L-ALPHA-PHOSPHATIDYL-BETA-OLEOYL-GAMMA-PALMITOYL-PHOSPHATIDYLETHANOLAMINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
MABRTXOVHMDVAT-AAEGOEIASA-N
SMILES
CCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCC=CCCC=CCCC=CC)COP(=O)(O)OCCN
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3VR8
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3vr8A1e3vr8A2e3vr8A3e3vr8B1e3vr8B2e3vr8C1e3vr8D1e3vr8E1e3vr8E10e3vr8E9e3vr8F5e3vr8F6e3vr8G2e3vr8H2
ECOD domains from experimental PDB structures interacting with ligand DB03047
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P92506 | DB03047 | EPH | 3vr8 | e3vr8C1 | C:34-186 |
| P92506 | DB03047 | EPH | 3vr8 | e3vr8G2 | G:34-183 |
| P92506 | DB03047 | EPH | 3vr9 | e3vr9C1 | C:34-186 |
| P92506 | DB03047 | EPH | 3vr9 | e3vr9G1 | G:34-186 |
| P92506 | DB03047 | EPH | 3vra | e3vraC1 | C:34-186 |
| P92506 | DB03047 | EPH | 3vra | e3vraG1 | G:34-186 |
| P92506 | DB03047 | EPH | 3vrb | e3vrbC2 | C:34-186 |
| P92506 | DB03047 | EPH | 3vrb | e3vrbG2 | G:34-183 |
| P92506 | DB03047 | EPH | 4ysx | e4ysxC1 | C:34-186 |
| P92506 | DB03047 | EPH | 4ysx | e4ysxG1 | G:34-188 |
| P92506 | DB03047 | EPH | 4ysy | e4ysyC1 | C:34-186 |
| P92506 | DB03047 | EPH | 4ysy | e4ysyG1 | G:34-186 |
| P92506 | DB03047 | EPH | 4ysz | e4yszC1 | C:34-186 |
| P92506 | DB03047 | EPH | 4ysz | e4yszG1 | G:34-186 |
| P92506 | DB03047 | EPH | 4ytm | e4ytmC1 | C:34-185 |
| P92506 | DB03047 | EPH | 5c2t | e5c2tC1 | C:34-186 |
| P92506 | DB03047 | EPH | 5c2t | e5c2tG1 | G:34-186 |
| P92506 | DB03047 | EPH | 5c3j | e5c3jC1 | C:34-186 |
| P92506 | DB03047 | EPH | 5c3j | e5c3jG1 | G:34-186 |