Attributes
UniProt ID
Protein Name
3-isopropylmalate dehydrogenase 2, chloroplastic
Ligand Name
NICOTINAMIDE-ADENINE-DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BAWFJGJZGIEFAR-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5J33
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5j33A1e5j33A2e5j33B1e5j33B2e5j33C1e5j33C2e5j33D1e5j33D2e5j33E1e5j33E2e5j33F1e5j33F2e5j33G1e5j33G2e5j33H1e5j33H2
ECOD domains from experimental PDB structures interacting with ligand DB14128
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P93832 | DB14128 | NAD | 5j33 | e5j33A1 | A:41-141,A:299-400 |
| P93832 | DB14128 | NAD | 5j33 | e5j33A2 | A:142-298 |
| P93832 | DB14128 | NAD | 5j33 | e5j33B1 | B:41-141,B:299-399 |
| P93832 | DB14128 | NAD | 5j33 | e5j33B2 | B:142-298 |
| P93832 | DB14128 | NAD | 5j33 | e5j33C1 | C:142-298 |
| P93832 | DB14128 | NAD | 5j33 | e5j33C2 | C:41-141,C:299-399 |
| P93832 | DB14128 | NAD | 5j33 | e5j33D1 | D:142-298 |
| P93832 | DB14128 | NAD | 5j33 | e5j33E1 | E:41-141,E:299-399 |
| P93832 | DB14128 | NAD | 5j33 | e5j33E2 | E:142-298 |
| P93832 | DB14128 | NAD | 5j33 | e5j33F1 | F:142-298 |
| P93832 | DB14128 | NAD | 5j33 | e5j33F2 | F:41-141,F:299-399 |
| P93832 | DB14128 | NAD | 5j33 | e5j33G1 | G:142-298 |
| P93832 | DB14128 | NAD | 5j33 | e5j33G2 | G:41-141,G:299-399 |
| P93832 | DB14128 | NAD | 5j33 | e5j33H1 | H:44-141,H:299-398 |
| P93832 | DB14128 | NAD | 5j33 | e5j33H2 | H:142-298 |