Attributes
UniProt ID
Protein Name
Pyruvate:ferredoxin oxidoreductase
Ligand Name
THIAMINE DIPHOSPHATE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
AYEKOFBPNLCAJY-UHFFFAOYSA-O
SMILES
Cc1c(sc[n+]1Cc2cnc(nc2N)C)CCOP(=O)(O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1B0P
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1b0pA1e1b0pA2e1b0pA3e1b0pA4e1b0pA5e1b0pA6e1b0pB1e1b0pB2e1b0pB3e1b0pB4e1b0pB5e1b0pB6
ECOD domains from experimental PDB structures interacting with ligand TPP
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P94692 | n/a | TPP | 1b0p | e1b0pA4 | A:2-258 |
| P94692 | n/a | TPP | 1b0p | e1b0pA6 | A:786-882,A:955-1232 |
| P94692 | n/a | TPP | 1b0p | e1b0pB4 | B:2-258 |
| P94692 | n/a | TPP | 1b0p | e1b0pB5 | B:786-882,B:955-1232 |
| P94692 | n/a | TPP | 2c3m | e2c3mA4 | A:2-258 |
| P94692 | n/a | TPP | 2c3m | e2c3mA6 | A:786-882,A:955-1232 |
| P94692 | n/a | TPP | 2c3m | e2c3mB4 | B:2-258 |
| P94692 | n/a | TPP | 2c3m | e2c3mB5 | B:786-882,B:955-1232 |
| P94692 | n/a | TPP | 2c3o | e2c3oA4 | A:2-258 |
| P94692 | n/a | TPP | 2c3o | e2c3oA5 | A:786-882,A:955-1232 |
| P94692 | n/a | TPP | 2c3o | e2c3oB4 | B:2-258 |
| P94692 | n/a | TPP | 2c3o | e2c3oB6 | B:786-882,B:955-1232 |
| P94692 | n/a | TPP | 2c42 | e2c42A4 | A:2-258 |
| P94692 | n/a | TPP | 2c42 | e2c42A7 | A:786-882,A:955-1232 |
| P94692 | n/a | TPP | 2c42 | e2c42B4 | B:2-258 |
| P94692 | n/a | TPP | 2c42 | e2c42B6 | B:786-882,B:955-1232 |
| P94692 | n/a | TPP | 2pda | e2pdaA4 | A:2-258 |
| P94692 | n/a | TPP | 2pda | e2pdaA5 | A:786-882,A:955-1232 |
| P94692 | n/a | TPP | 2pda | e2pdaB4 | B:2-258 |
| P94692 | n/a | TPP | 2pda | e2pdaB6 | B:786-882,B:955-1232 |
| P94692 | n/a | TPP | 7plm | e7plmA2 | A:2-258 |
| P94692 | n/a | TPP | 7plm | e7plmA6 | A:786-882,A:955-1230 |
| P94692 | n/a | TPP | 7plm | e7plmB4 | B:2-258 |
| P94692 | n/a | TPP | 7plm | e7plmB5 | B:786-882,B:955-1230 |