Attributes
UniProt ID
Protein Name
Enoyl- reductase
Ligand Name
NICOTINAMIDE-ADENINE-DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BAWFJGJZGIEFAR-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4D0R
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4d0rA1
ECOD domains from experimental PDB structures interacting with ligand DB14128
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P9WGR0 | DB14128 | NAD | 4d0r | e4d0rA1 | A:2-269 |
| P9WGR0 | DB14128 | NAD | 4d0s | e4d0sA1 | A:3-269 |
| P9WGR0 | DB14128 | NAD | 4d0s | e4d0sB1 | B:2-269 |
| P9WGR0 | DB14128 | NAD | 4d0s | e4d0sC1 | C:2-269 |
| P9WGR0 | DB14128 | NAD | 4d0s | e4d0sD1 | D:3-269 |
| P9WGR0 | DB14128 | NAD | 4trj | e4trjA1 | A:2-269 |
| P9WGR0 | DB14128 | NAD | 4trn | e4trnA1 | A:2-269 |
| P9WGR0 | DB14128 | NAD | 5cpf | e5cpfA1 | A:3-269 |
| P9WGR0 | DB14128 | NAD | 5cpf | e5cpfB1 | B:3-269 |
| P9WGR0 | DB14128 | NAD | 5cpf | e5cpfC1 | C:3-269 |
| P9WGR0 | DB14128 | NAD | 5cpf | e5cpfD1 | D:3-269 |
| P9WGR0 | DB14128 | NAD | 5mtp | e5mtpA1 | A:2-269 |
| P9WGR0 | DB14128 | NAD | 5mtp | e5mtpB1 | B:2-269 |
| P9WGR0 | DB14128 | NAD | 5mtp | e5mtpC1 | C:2-269 |
| P9WGR0 | DB14128 | NAD | 5mtp | e5mtpD1 | D:2-269 |
| P9WGR0 | DB14128 | NAD | 5mtp | e5mtpE1 | E:2-269 |
| P9WGR0 | DB14128 | NAD | 5mtp | e5mtpF1 | F:2-269 |
| P9WGR0 | DB14128 | NAD | 5mtp | e5mtpG1 | G:2-269 |
| P9WGR0 | DB14128 | NAD | 5mtp | e5mtpH1 | H:2-269 |
| P9WGR0 | DB14128 | NAD | 6yuu | e6yuuA1 | A:2-269 |