Attributes
UniProt ID
Protein Name
Uridylate kinase
Ligand Name
URIDINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XCCTYIAWTASOJW-XVFCMESISA-N
SMILES
C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7BIX
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7bixA1e7bixB1e7bixC1e7bixD1e7bixE1e7bixF1e7bixG1e7bixH1e7bixI1e7bixJ1e7bixK1e7bixL1
ECOD domains from experimental PDB structures interacting with ligand DB03435
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P9WHK5 | DB03435 | UDP | 7bix | e7bixB1 | B:28-261 |
| P9WHK5 | DB03435 | UDP | 7bix | e7bixC1 | C:28-261 |
| P9WHK5 | DB03435 | UDP | 7bix | e7bixD1 | D:28-261 |
| P9WHK5 | DB03435 | UDP | 7bix | e7bixE1 | E:28-261 |
| P9WHK5 | DB03435 | UDP | 7bix | e7bixH1 | H:28-261 |
| P9WHK5 | DB03435 | UDP | 7bix | e7bixI1 | I:28-261 |
| P9WHK5 | DB03435 | UDP | 7bix | e7bixJ1 | J:28-261 |
| P9WHK5 | DB03435 | UDP | 7bix | e7bixK1 | K:28-261 |
| P9WHK5 | DB03435 | UDP | 7bl7 | e7bl7B1 | B:28-261 |
| P9WHK5 | DB03435 | UDP | 7bl7 | e7bl7C1 | C:28-261 |
| P9WHK5 | DB03435 | UDP | 7bl7 | e7bl7D1 | D:28-261 |
| P9WHK5 | DB03435 | UDP | 7bl7 | e7bl7E1 | E:29-261 |
| P9WHK5 | DB03435 | UDP | 7bl7 | e7bl7H1 | H:29-261 |
| P9WHK5 | DB03435 | UDP | 7bl7 | e7bl7I1 | I:28-261 |
| P9WHK5 | DB03435 | UDP | 7bl7 | e7bl7J1 | J:29-261 |
| P9WHK5 | DB03435 | UDP | 7bl7 | e7bl7K1 | K:27-261 |