Attributes
UniProt ID
Protein Name
Probable cystathionine beta-synthase Rv1077
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7XNZ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7xnzA1e7xnzA2e7xnzA3e7xnzB1e7xnzB2e7xnzB3e7xnzC1e7xnzC2e7xnzC3e7xnzD1e7xnzD2e7xnzD3
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P9WP51 | DB00114 | PLP | 7xnz | e7xnzA1 | A:157-321 |
| P9WP51 | DB00114 | PLP | 7xnz | e7xnzA2 | A:3-156 |
| P9WP51 | DB00114 | PLP | 7xnz | e7xnzB1 | B:3-156 |
| P9WP51 | DB00114 | PLP | 7xnz | e7xnzB2 | B:157-321 |
| P9WP51 | DB00114 | PLP | 7xnz | e7xnzC1 | C:157-321 |
| P9WP51 | DB00114 | PLP | 7xnz | e7xnzC3 | C:3-156 |
| P9WP51 | DB00114 | PLP | 7xnz | e7xnzD1 | D:157-321 |
| P9WP51 | DB00114 | PLP | 7xnz | e7xnzD3 | D:3-156 |
| P9WP51 | DB00114 | PLP | 7xoh | e7xohA2 | A:3-156 |
| P9WP51 | DB00114 | PLP | 7xoh | e7xohA3 | A:157-321 |
| P9WP51 | DB00114 | PLP | 7xoh | e7xohB1 | B:157-321 |
| P9WP51 | DB00114 | PLP | 7xoh | e7xohB2 | B:3-156 |
| P9WP51 | DB00114 | PLP | 7xoh | e7xohC1 | C:3-156 |
| P9WP51 | DB00114 | PLP | 7xoh | e7xohC2 | C:157-321 |
| P9WP51 | DB00114 | PLP | 7xoh | e7xohD2 | D:3-156 |
| P9WP51 | DB00114 | PLP | 7xoh | e7xohD3 | D:157-321 |